2-chloro-N-(4-(5-(cyclobutanecarboxamido)-1H-benzo[d]imidazol-2-yl)phenyl)benzamide

ID: ALA214445

PubChem CID: 44416537

Max Phase: Preclinical

Molecular Formula: C25H21ClN4O2

Molecular Weight: 444.92

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(-c2nc3cc(NC(=O)C4CCC4)ccc3[nH]2)cc1)c1ccccc1Cl

Standard InChI:  InChI=1S/C25H21ClN4O2/c26-20-7-2-1-6-19(20)25(32)27-17-10-8-15(9-11-17)23-29-21-13-12-18(14-22(21)30-23)28-24(31)16-4-3-5-16/h1-2,6-14,16H,3-5H2,(H,27,32)(H,28,31)(H,29,30)

Standard InChI Key:  UGUHVOJNAPXDDU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    0.9347    0.0526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3335   -0.6682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1579   -0.6799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5832    0.0300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1741    0.7532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3511    0.7615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1096    0.0632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7317    0.8648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0159    0.4512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0146   -0.3739    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3013    0.8670    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5855    0.4535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5889   -0.3701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8781   -0.7794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8820    0.8714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3821    0.7250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1665    0.4617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1601   -0.3653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3707   -0.6120    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4083    0.0196    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8098   -0.7007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6349   -0.7109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3904   -1.4105    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0385   -1.4314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8628   -1.4421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2831   -0.7316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8772   -0.0090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0542   -0.0018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6457    0.7169    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -4.9410    1.6607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7378    1.4470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5240    0.6501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 17 18  1  0
  3  4  1  0
  8  9  1  0
  4  5  2  0
 16 17  1  0
 18 19  1  0
 19  7  1  0
  7 16  2  0
  9 10  2  0
  4 20  1  0
  2  3  2  0
 20 21  1  0
  9 11  1  0
 21 22  1  0
  5  6  1  0
 21 23  2  0
 11 12  1  0
 22 24  2  0
  6  1  2  0
 24 25  1  0
 12 13  2  0
 25 26  2  0
  1  2  1  0
 26 27  1  0
 13 14  1  0
 27 28  2  0
 28 22  1  0
 14 18  2  0
 28 29  1  0
  8 30  1  0
  1  7  1  0
 17 15  2  0
 15 12  1  0
 30 31  1  0
 31 32  1  0
 32  8  1  0
M  END

Associated Targets(Human)

NR2E3 Tchem Photoreceptor-specific nuclear receptor (502 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 444.92Molecular Weight (Monoisotopic): 444.1353AlogP: 5.87#Rotatable Bonds: 5
Polar Surface Area: 86.88Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.55CX Basic pKa: 5.16CX LogP: 5.44CX LogD: 5.44
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.36Np Likeness Score: -1.81

References

1. Wolkenberg SE, Zhao Z, Kapitskaya M, Webber AL, Petrukhin K, Tang YS, Dean DC, Hartman GD, Lindsley CW..  (2006)  Identification of potent agonists of photoreceptor-specific nuclear receptor (NR2E3) and preparation of a radioligand.,  16  (19): [PMID:16879962] [10.1016/j.bmcl.2006.07.056]

Source