2-chloro-N-(4-(5-(2,2-difluorocyclopropanecarboxamido)-1H-benzo[d]imidazol-2-yl)phenyl)benzamide

ID: ALA214457

PubChem CID: 44416477

Max Phase: Preclinical

Molecular Formula: C24H17ClF2N4O2

Molecular Weight: 466.88

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(-c2nc3cc(NC(=O)C4CC4(F)F)ccc3[nH]2)cc1)c1ccccc1Cl

Standard InChI:  InChI=1S/C24H17ClF2N4O2/c25-18-4-2-1-3-16(18)22(32)28-14-7-5-13(6-8-14)21-30-19-10-9-15(11-20(19)31-21)29-23(33)17-12-24(17,26)27/h1-11,17H,12H2,(H,28,32)(H,29,33)(H,30,31)

Standard InChI Key:  YYBRDJACMSSFST-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
    1.2398   -9.1620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6374   -9.8796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4623   -9.8933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8854   -9.1838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4787   -8.4626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6558   -8.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4138   -9.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4254   -8.3523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7112   -8.7616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7134   -9.5878    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2815   -8.7573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2866   -9.5811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5695   -9.9945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5756   -8.3414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0767   -8.4888    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8575   -8.7490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8520   -9.5779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1135   -9.9152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9395   -9.9268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6931  -10.6248    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3421  -10.6481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1628  -10.6601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5886   -9.9498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1804   -9.2252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3575   -9.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9518   -8.4998    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -4.8418   -7.6427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2511   -8.3569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0769   -8.3502    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5912   -9.0767    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9976   -8.3476    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0641   -9.8225    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7103   -9.1954    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  5  6  1  0
  6  1  2  0
  1  7  1  0
  8  9  1  0
  9 10  2  0
 11 12  2  0
 12 13  1  0
 13 17  2  0
 16 14  2  0
 14 11  1  0
 16 17  1  0
 15 16  1  0
  7 15  2  0
 18 19  1  0
 18 20  2  0
 19 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 19  1  0
 25 26  1  0
 27  8  1  0
 28 27  1  0
  8 28  1  0
 28 29  1  0
  1  2  1  0
 28 30  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
 17 32  1  0
 32  7  1  0
  9 31  1  0
 31 11  1  0
  4 33  1  0
 33 18  1  0
M  END

Associated Targets(Human)

NR2E3 Tchem Photoreceptor-specific nuclear receptor (502 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 466.88Molecular Weight (Monoisotopic): 466.1008AlogP: 5.73#Rotatable Bonds: 5
Polar Surface Area: 86.88Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.52CX Basic pKa: 5.16CX LogP: 4.87CX LogD: 4.87
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.35Np Likeness Score: -1.50

References

1. Wolkenberg SE, Zhao Z, Kapitskaya M, Webber AL, Petrukhin K, Tang YS, Dean DC, Hartman GD, Lindsley CW..  (2006)  Identification of potent agonists of photoreceptor-specific nuclear receptor (NR2E3) and preparation of a radioligand.,  16  (19): [PMID:16879962] [10.1016/j.bmcl.2006.07.056]

Source