SID49730577

ID: ALA2144768

PubChem CID: 24792764

Max Phase: Preclinical

Molecular Formula: C21H28N4O8S

Molecular Weight: 496.54

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)N1CCN(C(=O)CN2C(=O)COc3ccc(S(=O)(=O)N4CCOCC4)cc32)CC1

Standard InChI:  InChI=1S/C21H28N4O8S/c1-2-32-21(28)23-7-5-22(6-8-23)19(26)14-25-17-13-16(3-4-18(17)33-15-20(25)27)34(29,30)24-9-11-31-12-10-24/h3-4,13H,2,5-12,14-15H2,1H3

Standard InChI Key:  XWUTUCPXISLNTL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
    3.8926    1.4991    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964   -1.4973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8923    2.6991    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8533    2.0989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6486    1.3517    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7919   -0.7489    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6288    3.1588    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2462   10.4969    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5860   10.3640    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964    1.4973    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1929    0.7495    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5812    5.2552    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5634    8.2553    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2907    2.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5870    3.7544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1938   -0.7505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4914    1.5003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4933   -1.4997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7909    0.7511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8757    6.0130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2777    5.9976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8669    7.5130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2688    7.4976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5514    9.7561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2342   11.9977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1906   12.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  3  2  0
  1  4  2  0
  1 11  1  0
  1 15  1  0
  2 16  1  0
  2 22  1  0
  5 18  2  0
  6 26  1  0
  6 27  1  0
  7 23  2  0
  8 32  1  0
  8 33  1  0
  9 32  2  0
 10 14  1  0
 10 18  1  0
 10 21  1  0
 11 24  1  0
 11 25  1  0
 12 23  1  0
 12 28  1  0
 12 29  1  0
 13 30  1  0
 13 31  1  0
 13 32  1  0
 14 16  1  0
 14 17  2  0
 15 17  1  0
 15 19  2  0
 16 20  2  0
 18 22  1  0
 19 20  1  0
 21 23  1  0
 24 26  1  0
 25 27  1  0
 28 30  1  0
 29 31  1  0
 33 34  1  0
M  END

Associated Targets(Human)

CGA Tbio Glycoprotein hormones alpha chain (29278 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PTH1R Tclin Parathyroid hormone receptor (47172 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 496.54Molecular Weight (Monoisotopic): 496.1628AlogP: -0.27#Rotatable Bonds: 5
Polar Surface Area: 126.00Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 12HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: -1.38CX LogD: -1.38
Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.55Np Likeness Score: -1.96

References

1. PubChem BioAssay data set, 

Source

Source(1):