The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID49730577 ID: ALA2144768
PubChem CID: 24792764
Max Phase: Preclinical
Molecular Formula: C21H28N4O8S
Molecular Weight: 496.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)N1CCN(C(=O)CN2C(=O)COc3ccc(S(=O)(=O)N4CCOCC4)cc32)CC1
Standard InChI: InChI=1S/C21H28N4O8S/c1-2-32-21(28)23-7-5-22(6-8-23)19(26)14-25-17-13-16(3-4-18(17)33-15-20(25)27)34(29,30)24-9-11-31-12-10-24/h3-4,13H,2,5-12,14-15H2,1H3
Standard InChI Key: XWUTUCPXISLNTL-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
3.8926 1.4991 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8923 2.6991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8533 2.0989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6486 1.3517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7919 -0.7489 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6288 3.1588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2462 10.4969 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5860 10.3640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1929 0.7495 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5812 5.2552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5634 8.2553 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 2.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5870 3.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1938 -0.7505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4914 1.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4933 -1.4997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7909 0.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8757 6.0130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2777 5.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8669 7.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2688 7.4976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5514 9.7561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2342 11.9977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1906 12.5900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 3 2 0
1 4 2 0
1 11 1 0
1 15 1 0
2 16 1 0
2 22 1 0
5 18 2 0
6 26 1 0
6 27 1 0
7 23 2 0
8 32 1 0
8 33 1 0
9 32 2 0
10 14 1 0
10 18 1 0
10 21 1 0
11 24 1 0
11 25 1 0
12 23 1 0
12 28 1 0
12 29 1 0
13 30 1 0
13 31 1 0
13 32 1 0
14 16 1 0
14 17 2 0
15 17 1 0
15 19 2 0
16 20 2 0
18 22 1 0
19 20 1 0
21 23 1 0
24 26 1 0
25 27 1 0
28 30 1 0
29 31 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 496.54Molecular Weight (Monoisotopic): 496.1628AlogP: -0.27#Rotatable Bonds: 5Polar Surface Area: 126.00Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 12HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: -1.38CX LogD: -1.38Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.55Np Likeness Score: -1.96
References 1. PubChem BioAssay data set,