(S)-2-{(2S,3S)-2-[(S)-2-{[3-(6-Guanidino-hexyl)-7-(5-guanidino-pentyloxy)-1H-indole-2-carbonyl]-amino}-3-(4-hydroxy-phenyl)-propionylamino]-3-methyl-pentanoylamino}-4-methyl-pentanoic acid with di TFA

ID: ALA21448

PubChem CID: 44274347

Max Phase: Preclinical

Molecular Formula: C45H67F3N10O9

Molecular Weight: 835.06

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Bioactivity Summary Target Summary Assay Summary

Names and Identifiers

Canonical SMILES: CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)c1[nH]c2c(OCCCCCN=C(N)N)cccc2c1CCCCCCN=C(N)N)C(=O)N[C@@H](CC(C)C)C(=O)O.O=C(O)C(F)(F)F

Standard InChI: InChI=1S/C43H66N10O7.C2HF3O2/c1-5-27(4)35(39(56)51-33(41(58)59)24-26(2)3)53-38(55)32(25-28-17-19-29(54)20-18-28)50-40(57)37-31(14-9-6-7-10-21-48-42(44)45)30-15-13-16-34(36(30)52-37)60-23-12-8-11-22-49-43(46)47;3-2(4,5)1(6)7/h13,15-20,26-27,32-33,35,52,54H,5-12,14,21-25H2,1-4H3,(H,50,57)(H,51,56)(H,53,55)(H,58,59)(H4,44,45,48)(H4,46,47,49);(H,6,7)/t27-,32-,33-,35-;/m0./s1

Standard InChI Key: UBEOEKAXELGWOF-UXMXCWPGSA-N

Molfile:

     RDKit          2D

 67 68  0  0  0  0  0  0  0  0999 V2000
   -3.7458   -7.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0333   -7.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0333   -6.3417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4708   -8.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3333   -8.3042    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1625   -6.8625    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3208   -7.5875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9958   -1.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4875   -1.6875    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4875   -0.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1708   -1.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2750   -1.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2750   -0.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5417   -3.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3042   -2.4417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4792   -2.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2417   -1.7292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9542   -3.8667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7167   -3.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0667   -1.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8542   -1.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7625    3.4833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7792   -3.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1917   -4.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4042   -0.8292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3125    2.8708    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2417   -0.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9958   -1.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9542   -2.4417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0667   -3.1542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4792   -1.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7792   -5.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1917   -3.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9542    3.3125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0542   -1.2917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0167    4.2667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1250   -2.2375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3042   -3.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2750   -0.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0167   -4.5792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2333    0.4458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8625   -0.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9958   -0.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8542   -1.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4792    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9958   -2.6667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2667    0.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6542   -1.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6542   -0.1375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7083   -0.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0167   -3.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7083   -1.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5042   -1.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7000    2.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4792   -3.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7167   -4.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8000   -2.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4250    0.6208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8917    2.3583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7083   -1.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3458   -2.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4292   -3.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4292   -2.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6375    1.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1583   -2.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1708    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0667   -4.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  1  1  0
  5  1  1  0
  6  1  1  0
  7  2  1  0
  9  8  1  0
 10  8  2  0
 11  8  1  0
 12  9  1  0
 13 10  1  0
 14 19  1  0
 15 16  1  0
 16 20  1  0
 17 11  1  0
 18 14  1  0
 19 15  1  6
 20 17  1  1
 21 35  2  0
 22 34  2  0
 23 18  1  1
 24 23  1  0
 25 21  1  0
 26 22  1  0
 27 11  2  0
 28 12  2  0
 29 14  2  0
 30 16  2  0
 20 31  1  0
 32 24  2  0
 23 33  1  0
 34 54  1  0
 35 53  1  0
 36 22  1  0
 37 21  1  0
 19 38  1  0
 39 31  1  0
 40 24  1  0
 41 10  1  0
 42 48  2  0
 43 13  2  0
 44 39  2  0
 45 39  1  0
 46 28  1  0
 47 45  2  0
 48 44  1  0
 49 42  1  0
 50 43  1  0
 51 33  1  0
 52 28  1  0
 53 60  1  0
 54 59  1  0
 55 38  1  0
 38 56  1  1
 57 46  1  0
 58 41  1  0
 59 64  1  0
 60 65  1  0
 61 57  1  0
 62 51  1  0
 63 51  1  0
 64 66  1  0
 65 61  1  0
 66 58  1  0
 67 55  1  0
 12 13  1  0
 52 50  2  0
 47 42  1  0
M  END

Associated Targets(Human)

NTSR2 Tchem Neurotensin receptor (16 Activities)

Discover Target: NTSR2

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

Homo sapiens (32628 Activities)

Explore this target

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

Natural Product: No	Oral: No	Chemical Probe: No	Parenteral: No
Molecule Type: Small molecule	Topical: No	First In Class: No	Black Box: No
Chirality: No	Availability: No	Prodrug: No

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 835.06	Molecular Weight (Monoisotopic): 834.5116	AlogP: 3.56	#Rotatable Bonds: 27
Polar Surface Area: 298.65	Molecular Species: ZWITTERION	HBA: 8	HBD: 10
#RO5 Violations: 2	HBA (Lipinski): 17	HBD (Lipinski): 14	#RO5 Violations (Lipinski): 3
CX Acidic pKa: 4.11	CX Basic pKa: 11.79	CX LogP: 0.89	CX LogD: 0.41
Aromatic Rings: 3	Heavy Atoms: 60	QED Weighted: 0.03	Np Likeness Score: 0.23

References

1. Dood DS, Kozikowski AP, Cusack B, Richelson E. (1994) Synthesis of partially non-peptidic neurotensin mimetics, 4 (10): [10.1016/S0960-894X(01)80338-3]
2. Chalon, P P and 8 more authors. 1996-05-20 Molecular cloning of a levocabastine-sensitive neurotensin binding site. [PMID:8647296]
3. Hughes, Francis M and 10 more authors. 2010-06-24 Identification and functional characterization of a stable, centrally active derivative of the neurotensin (8-13) fragment as a potential first-in-class analgesic. [PMID:20481538]
4. Fanelli, Roberto R and 9 more authors. 2017-04-27 Use of Molecular Modeling to Design Selective NTS2 Neurotensin Analogues. [PMID:28368584]
5. Keller, Max and 10 more authors. 2020-01-09 Fluorescence Labeling of Neurotensin(8-13) via Arginine Residues Gives Molecular Tools with High Receptor Affinity. [PMID:31938457]
6. Chartier, Magali and 6 more authors. 2021-02-25 Design, Structural Optimization, and Characterization of the First Selective Macrocyclic Neurotensin Receptor Type 2 Non-opioid Analgesic. [PMID:33538583]

(S)-2-{(2S,3S)-2-[(S)-2-{[3-(6-Guanidino-hexyl)-7-(5-guanidino-pentyloxy)-1H-indole-2-carbonyl]-amino}-3-(4-hydroxy-phenyl)-propionylamino]-3-methyl-pentanoylamino}-4-methyl-pentanoic acid with di TFA

Names and Identifiers

Associated Targets(Human)

Associated Targets(non-human)

Molecule Features

Drug Indications

Mechanisms of Action

Biocomponents

Calculated Properties

References

Source