The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID57267436 ID: ALA2145197
PubChem CID: 25163369
Max Phase: Preclinical
Molecular Formula: C23H30N4O6S
Molecular Weight: 490.58
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)NC12CC3CC(C1)CC(C(=O)N1CCN(S(=O)(=O)c4cccc([N+](=O)[O-])c4)CC1)(C3)C2
Standard InChI: InChI=1S/C23H30N4O6S/c1-16(28)24-23-13-17-9-18(14-23)12-22(11-17,15-23)21(29)25-5-7-26(8-6-25)34(32,33)20-4-2-3-19(10-20)27(30)31/h2-4,10,17-18H,5-9,11-15H2,1H3,(H,24,28)
Standard InChI Key: KUKSUPNXWXXGPJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
2.0721 2.4113 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.2978 0.9454 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0433 3.0707 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4868 2.7162 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2279 -1.2054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5132 2.2349 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8972 3.1978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0161 1.0818 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0508 -0.6792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3758 1.9680 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9271 2.5384 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6765 -0.1760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2530 -0.8140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2695 -0.3685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7130 0.6395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5675 -0.8360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4300 -1.1990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5675 -0.4070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3970 -0.7480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7700 -0.9955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6160 -1.4190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4640 -1.2155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7157 0.7007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0518 1.9061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8044 2.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5771 -1.3152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4116 1.1438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6442 2.3492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5001 2.4740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8407 1.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2320 2.0932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5726 0.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2683 1.2690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3469 -1.9337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 3 2 0
1 4 2 0
1 10 1 0
1 25 1 0
2 15 2 0
5 26 2 0
6 11 1 0
7 11 2 0
8 15 1 0
8 23 1 0
8 24 1 0
9 13 1 0
9 26 1 0
10 27 1 0
10 28 1 0
11 31 1 0
12 14 1 0
12 15 1 0
12 18 1 0
12 19 1 0
13 14 1 0
13 20 1 0
13 21 1 0
16 18 1 0
16 20 1 0
16 22 1 0
17 19 1 0
17 21 1 0
17 22 1 0
23 27 1 0
24 28 1 0
25 29 1 0
25 30 2 0
26 34 1 0
29 31 2 0
30 32 1 0
31 33 1 0
32 33 2 0
M CHG 2 6 -1 11 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 490.58Molecular Weight (Monoisotopic): 490.1886AlogP: 1.90#Rotatable Bonds: 5Polar Surface Area: 129.93Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.19CX LogP: 1.04CX LogD: 1.04Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.50Np Likeness Score: -1.82
References 1. PubChem BioAssay data set,