The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID24268398 ID: ALA2145404
PubChem CID: 15988234
Max Phase: Preclinical
Molecular Formula: C28H29N3O7
Molecular Weight: 519.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(OC)cc(-n2c(=O)c3ccccc3n(CC(=O)NCCc3ccc(OC)c(OC)c3)c2=O)c1
Standard InChI: InChI=1S/C28H29N3O7/c1-35-20-14-19(15-21(16-20)36-2)31-27(33)22-7-5-6-8-23(22)30(28(31)34)17-26(32)29-12-11-18-9-10-24(37-3)25(13-18)38-4/h5-10,13-16H,11-12,17H2,1-4H3,(H,29,32)
Standard InChI Key: XLAOVVJJOOMHRX-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
5.0790 -6.4000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6670 -9.1420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0420 -7.7750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4500 -5.0290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4920 -10.0420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9170 -15.5290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3290 -14.6290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8670 -7.7670 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0790 -9.1380 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2790 -11.4170 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2880 -8.6790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2880 -7.7670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0790 -7.3130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8670 -8.6790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6630 -7.3130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5000 -9.1380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5000 -7.3130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0750 -10.0420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6630 -6.3920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4500 -7.7670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2420 -7.3130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4500 -5.9420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7000 -8.6790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7000 -7.7670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2790 -10.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2420 -6.3920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7000 -13.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4920 -11.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9170 -14.6170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1250 -14.1630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7000 -14.1630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4920 -12.7920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9170 -12.7920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1250 -13.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0290 -8.6920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2420 -4.5670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7000 -16.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3290 -15.5420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 13 2 0
2 14 2 0
3 21 1 0
3 35 1 0
4 22 1 0
4 36 1 0
5 25 2 0
6 29 1 0
6 37 1 0
7 30 1 0
7 38 1 0
8 13 1 0
8 14 1 0
8 15 1 0
9 11 1 0
9 14 1 0
9 18 1 0
10 25 1 0
10 28 1 0
11 12 2 0
11 16 1 0
12 13 1 0
12 17 1 0
15 19 2 0
15 20 1 0
16 23 2 0
17 24 2 0
18 25 1 0
19 22 1 0
20 21 2 0
21 26 1 0
22 26 2 0
23 24 1 0
27 31 2 0
27 32 1 0
27 33 1 0
28 32 1 0
29 30 2 0
29 31 1 0
30 34 1 0
33 34 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.55Molecular Weight (Monoisotopic): 519.2006AlogP: 2.55#Rotatable Bonds: 10Polar Surface Area: 110.02Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.77CX LogD: 2.77Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.34Np Likeness Score: -1.00
References 1. PubChem BioAssay data set,