The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID24384492 ID: ALA2145418
PubChem CID: 16008308
Max Phase: Preclinical
Molecular Formula: C24H30ClN5O2
Molecular Weight: 455.99
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCCCNC(=O)C1CCN(c2cc(C)nc3c(-c4ccc(Cl)cc4)c(C)nn23)CC1
Standard InChI: InChI=1S/C24H30ClN5O2/c1-16-15-21(29-12-9-19(10-13-29)24(31)26-11-4-14-32-3)30-23(27-16)22(17(2)28-30)18-5-7-20(25)8-6-18/h5-8,15,19H,4,9-14H2,1-3H3,(H,26,31)
Standard InChI Key: MELKNEAFOMKNFC-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-0.6710 -4.1170 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.7580 3.4210 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1710 5.6670 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4460 -0.3290 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7330 -0.1040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.0960 -1.4540 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.0960 0.7960 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4580 3.4210 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4460 -1.0790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7330 -1.3130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0960 0.0460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2960 -0.7170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4710 -2.0130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7460 -0.3290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7460 -1.0790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9460 -2.5920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7250 -2.1290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7380 1.1710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4460 1.1710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5460 -0.7290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0960 2.2960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7380 1.9210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4460 1.9210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3960 -1.4630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6750 -3.2920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4580 -2.8290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9330 -3.4130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1000 3.0460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4630 4.1670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8210 4.5420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8210 5.2920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1710 6.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 27 1 0
2 28 2 0
3 31 1 0
3 32 1 0
4 5 1 0
4 9 1 0
4 11 1 0
5 12 2 0
6 9 1 0
6 15 2 0
7 11 1 0
7 18 1 0
7 19 1 0
8 28 1 0
8 29 1 0
9 10 2 0
10 12 1 0
10 13 1 0
11 14 2 0
12 20 1 0
13 16 2 0
13 17 1 0
14 15 1 0
15 24 1 0
16 25 1 0
17 26 2 0
18 22 1 0
19 23 1 0
21 22 1 0
21 23 1 0
21 28 1 0
25 27 2 0
26 27 1 0
29 30 1 0
30 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 455.99Molecular Weight (Monoisotopic): 455.2088AlogP: 4.04#Rotatable Bonds: 7Polar Surface Area: 71.76Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.44CX LogP: 2.87CX LogD: 2.87Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.54Np Likeness Score: -1.80
References 1. PubChem BioAssay data set,