2-chloro-N-(4-(5-(1-phenylcyclopropanecarboxamido)-1H-benzo[d]imidazol-2-yl)phenyl)benzamide

ID: ALA214562

PubChem CID: 44416406

Max Phase: Preclinical

Molecular Formula: C30H23ClN4O2

Molecular Weight: 506.99

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(-c2nc3cc(NC(=O)C4(c5ccccc5)CC4)ccc3[nH]2)cc1)c1ccccc1Cl

Standard InChI:  InChI=1S/C30H23ClN4O2/c31-24-9-5-4-8-23(24)28(36)32-21-12-10-19(11-13-21)27-34-25-15-14-22(18-26(25)35-27)33-29(37)30(16-17-30)20-6-2-1-3-7-20/h1-15,18H,16-17H2,(H,32,36)(H,33,37)(H,34,35)

Standard InChI Key:  LOHXCMOSJQRMDT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
   10.5341  -14.7437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9688  -14.0442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1442  -14.0166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2075  -15.5535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6058  -16.2724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4323  -16.2862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8561  -15.5754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4486  -14.8527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6243  -14.8443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3798  -15.5416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2497  -15.1537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2475  -15.9815    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6793  -15.1481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6742  -15.9733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3928  -16.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3867  -14.7313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8885  -14.8790    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1060  -15.1398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1117  -15.9702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0843  -16.3067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9119  -16.3183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6631  -17.0176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3152  -17.0410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1375  -17.0530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5642  -16.3414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1552  -15.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3307  -15.6086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9241  -14.8887    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.8222  -15.1577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1077  -14.7466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3963  -15.1600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3985  -15.9845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1180  -16.3938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8265  -15.9780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9629  -14.7390    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.9002  -16.2129    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.6811  -15.5870    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  9  4  2  0
  4 10  1  0
  1 11  1  0
 11 12  2  0
 13 14  2  0
 14 15  1  0
 15 19  2  0
 18 16  2  0
 16 13  1  0
 18 19  1  0
 17 18  1  0
 10 17  2  0
 20 21  1  0
 20 22  2  0
 21 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 21  1  0
 27 28  1  0
  1 29  1  0
  2  1  1  0
 29 30  2  0
  3  2  1  0
 30 31  1  0
  1  3  1  0
 31 32  2  0
  4  5  1  0
 32 33  1  0
  5  6  2  0
 33 34  2  0
 34 29  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
 19 36  1  0
 36 10  1  0
 11 35  1  0
 35 13  1  0
  7 37  1  0
 37 20  1  0
M  END

Associated Targets(Human)

NR2E3 Tchem Photoreceptor-specific nuclear receptor (502 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 506.99Molecular Weight (Monoisotopic): 506.1510AlogP: 6.81#Rotatable Bonds: 6
Polar Surface Area: 86.88Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.54CX Basic pKa: 5.15CX LogP: 6.69CX LogD: 6.69
Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.24Np Likeness Score: -1.48

References

1. Wolkenberg SE, Zhao Z, Kapitskaya M, Webber AL, Petrukhin K, Tang YS, Dean DC, Hartman GD, Lindsley CW..  (2006)  Identification of potent agonists of photoreceptor-specific nuclear receptor (NR2E3) and preparation of a radioligand.,  16  (19): [PMID:16879962] [10.1016/j.bmcl.2006.07.056]

Source