The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-chloro-N-(4-(5-(1-phenylcyclopropanecarboxamido)-1H-benzo[d]imidazol-2-yl)phenyl)benzamide ID: ALA214562
PubChem CID: 44416406
Max Phase: Preclinical
Molecular Formula: C30H23ClN4O2
Molecular Weight: 506.99
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(-c2nc3cc(NC(=O)C4(c5ccccc5)CC4)ccc3[nH]2)cc1)c1ccccc1Cl
Standard InChI: InChI=1S/C30H23ClN4O2/c31-24-9-5-4-8-23(24)28(36)32-21-12-10-19(11-13-21)27-34-25-15-14-22(18-26(25)35-27)33-29(37)30(16-17-30)20-6-2-1-3-7-20/h1-15,18H,16-17H2,(H,32,36)(H,33,37)(H,34,35)
Standard InChI Key: LOHXCMOSJQRMDT-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
10.5341 -14.7437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9688 -14.0442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1442 -14.0166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2075 -15.5535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6058 -16.2724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4323 -16.2862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8561 -15.5754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4486 -14.8527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6243 -14.8443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3798 -15.5416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2497 -15.1537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2475 -15.9815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6793 -15.1481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6742 -15.9733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3928 -16.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3867 -14.7313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8885 -14.8790 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1060 -15.1398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1117 -15.9702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0843 -16.3067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9119 -16.3183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6631 -17.0176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.3152 -17.0410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1375 -17.0530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5642 -16.3414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1552 -15.6153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3307 -15.6086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9241 -14.8887 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.8222 -15.1577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1077 -14.7466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3963 -15.1600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3985 -15.9845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1180 -16.3938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8265 -15.9780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9629 -14.7390 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9002 -16.2129 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.6811 -15.5870 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9 4 2 0
4 10 1 0
1 11 1 0
11 12 2 0
13 14 2 0
14 15 1 0
15 19 2 0
18 16 2 0
16 13 1 0
18 19 1 0
17 18 1 0
10 17 2 0
20 21 1 0
20 22 2 0
21 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 21 1 0
27 28 1 0
1 29 1 0
2 1 1 0
29 30 2 0
3 2 1 0
30 31 1 0
1 3 1 0
31 32 2 0
4 5 1 0
32 33 1 0
5 6 2 0
33 34 2 0
34 29 1 0
6 7 1 0
7 8 2 0
8 9 1 0
19 36 1 0
36 10 1 0
11 35 1 0
35 13 1 0
7 37 1 0
37 20 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 506.99Molecular Weight (Monoisotopic): 506.1510AlogP: 6.81#Rotatable Bonds: 6Polar Surface Area: 86.88Molecular Species: NEUTRALHBA: 3HBD: 3#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.54CX Basic pKa: 5.15CX LogP: 6.69CX LogD: 6.69Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.24Np Likeness Score: -1.48
References 1. Wolkenberg SE, Zhao Z, Kapitskaya M, Webber AL, Petrukhin K, Tang YS, Dean DC, Hartman GD, Lindsley CW.. (2006) Identification of potent agonists of photoreceptor-specific nuclear receptor (NR2E3) and preparation of a radioligand., 16 (19): [PMID:16879962 ] [10.1016/j.bmcl.2006.07.056 ]