The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Galvaquinone C ID: ALA2152649
PubChem CID: 71461995
Max Phase: Preclinical
Molecular Formula: C20H18O6
Molecular Weight: 354.36
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Galvaquinone C | Galvaquinone C|CHEMBL2152649|CHEBI:198248|1,3,5-trihydroxy-2-methyl-4-(3-methylbutanoyl)anthracene-9,10-dione
Canonical SMILES: Cc1c(O)c(C(=O)CC(C)C)c2c(c1O)C(=O)c1cccc(O)c1C2=O
Standard InChI: InChI=1S/C20H18O6/c1-8(2)7-12(22)14-15-16(18(24)9(3)17(14)23)19(25)10-5-4-6-11(21)13(10)20(15)26/h4-6,8,21,23-24H,7H2,1-3H3
Standard InChI Key: JSBZNSHTZGINIT-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 28 0 0 0 0 0 0 0 0999 V2000
-5.8425 -2.4413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8437 -3.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1289 -3.6815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1307 -2.0287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4154 -2.4377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4146 -3.2645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6994 -3.6754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7050 -2.0236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9892 -2.4309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9856 -3.2604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2666 -3.6701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5506 -3.2516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5583 -2.4190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2779 -2.0129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6972 -4.5003 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7094 -1.1988 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.1270 -4.5064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2621 -4.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8478 -1.9997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8332 -3.6588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9742 -4.9115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5453 -4.9036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5408 -5.7285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8242 -6.1370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2530 -6.1449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2851 -1.1880 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5 6 1 0
12 13 1 0
3 6 2 0
13 14 2 0
14 9 1 0
6 7 1 0
7 15 2 0
7 10 1 0
8 16 2 0
1 2 2 0
3 17 1 0
9 8 1 0
11 18 1 0
8 5 1 0
13 19 1 0
5 4 2 0
12 20 1 0
4 1 1 0
18 21 2 0
9 10 2 0
18 22 1 0
22 23 1 0
10 11 1 0
23 24 1 0
2 3 1 0
23 25 1 0
11 12 2 0
14 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 354.36Molecular Weight (Monoisotopic): 354.1103AlogP: 3.12#Rotatable Bonds: 3Polar Surface Area: 111.90Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.01CX Basic pKa: ┄CX LogP: 5.46CX LogD: 4.85Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.62Np Likeness Score: 1.41
References 1. Hu Y, Martinez ED, MacMillan JB.. (2012) Anthraquinones from a marine-derived Streptomyces spinoverrucosus., 75 (10): [PMID:23057874 ] [10.1021/np3004326 ]