2-chloro-N-(4-(5-(1-cyanocyclopropanecarboxamido)-1H-benzo[d]imidazol-2-yl)phenyl)benzamide

ID: ALA215498

PubChem CID: 44416392

Max Phase: Preclinical

Molecular Formula: C25H18ClN5O2

Molecular Weight: 455.91

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#CC1(C(=O)Nc2ccc3[nH]c(-c4ccc(NC(=O)c5ccccc5Cl)cc4)nc3c2)CC1

Standard InChI:  InChI=1S/C25H18ClN5O2/c26-19-4-2-1-3-18(19)23(32)28-16-7-5-15(6-8-16)22-30-20-10-9-17(13-21(20)31-22)29-24(33)25(14-27)11-12-25/h1-10,13H,11-12H2,(H,28,32)(H,29,33)(H,30,31)

Standard InChI Key:  HMLGLKCTOQYTPQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   -3.0455  -14.3037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6110  -13.6045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4352  -13.5770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6259  -15.1136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0241  -15.8323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8502  -15.8460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2739  -15.1355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8666  -14.4132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0425  -14.4048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7987  -15.1017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3303  -14.7136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3325  -15.5410    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9006  -14.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9056  -15.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1875  -15.9473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1936  -14.2918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3075  -14.4394    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5255  -14.7001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5311  -15.5301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5019  -15.8668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3292  -15.8784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0810  -16.5774    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7323  -16.6007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5542  -16.6128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9807  -15.9014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5719  -15.1757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7478  -15.1691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3415  -14.4493    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -3.7570  -14.7176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4636  -15.1325    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6170  -14.2990    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3194  -15.7732    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0988  -15.1470    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  4  2  0
  4 10  1  0
  1 11  1  0
 11 12  2  0
 13 14  2  0
 14 15  1  0
 15 19  2  0
 18 16  2  0
 16 13  1  0
 18 19  1  0
 17 18  1  0
 10 17  2  0
 20 21  1  0
 20 22  2  0
 21 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 21  1  0
 27 28  1  0
  1 29  1  0
  2  1  1  0
 29 30  3  0
  3  2  1  0
  1  3  1  0
  4  5  1  0
 19 32  1  0
 32 10  1  0
 11 31  1  0
 31 13  1  0
  7 33  1  0
 33 20  1  0
M  END

Associated Targets(Human)

NR2E3 Tchem Photoreceptor-specific nuclear receptor (502 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 455.91Molecular Weight (Monoisotopic): 455.1149AlogP: 5.38#Rotatable Bonds: 5
Polar Surface Area: 110.67Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.52CX Basic pKa: 5.15CX LogP: 4.80CX LogD: 4.80
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.37Np Likeness Score: -1.66

References

1. Wolkenberg SE, Zhao Z, Kapitskaya M, Webber AL, Petrukhin K, Tang YS, Dean DC, Hartman GD, Lindsley CW..  (2006)  Identification of potent agonists of photoreceptor-specific nuclear receptor (NR2E3) and preparation of a radioligand.,  16  (19): [PMID:16879962] [10.1016/j.bmcl.2006.07.056]

Source