methyl 3-benzyl-1-methyl-4-oxo-9-phenyl-3,4-dihydropyrazolo[1',5':1,6]pyrimido[4,5-d]pyridazin-6-yl-propanoate

ID: ALA215699

PubChem CID: 11850082

Max Phase: Preclinical

Molecular Formula: C26H23N5O3

Molecular Weight: 453.50

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COC(=O)CCc1nc2c(=O)n(Cc3ccccc3)nc(C)c2c2cc(-c3ccccc3)nn12

Standard InChI:  InChI=1S/C26H23N5O3/c1-17-24-21-15-20(19-11-7-4-8-12-19)29-31(21)22(13-14-23(32)34-2)27-25(24)26(33)30(28-17)16-18-9-5-3-6-10-18/h3-12,15H,13-14,16H2,1-2H3

Standard InChI Key:  MUWBQLYNPGYQGE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   12.2645   -9.1265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0928   -9.1264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5088   -8.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1004   -7.7070    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2683   -7.7031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.8523   -8.4132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2607  -10.5538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8485   -9.8404    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5050   -9.8403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0906  -10.5526    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.6414  -11.1660    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.3939  -10.8302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3096  -10.0119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8614   -6.9856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2762   -6.2723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1007   -6.2823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5192   -5.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1084   -4.8514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2787   -4.8494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8677   -5.5624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3343   -8.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1087  -11.2460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1025  -12.0691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8126  -12.4810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5296  -12.0712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5282  -11.2415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8137  -10.8295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8514  -11.2700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0259  -11.2717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6127  -11.9880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7873  -11.9897    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0289  -12.7025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3749  -11.2752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0307   -8.4107    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 15 16  2  0
  7  8  2  0
 16 17  1  0
  9  2  1  0
 17 18  2  0
  1  8  1  0
 18 19  1  0
  9 10  1  0
 19 20  2  0
 20 15  1  0
  1  6  1  0
  3 21  1  0
  2  3  1  0
 12 22  1  0
  3  4  2  0
 22 23  2  0
  4  5  1  0
 23 24  1  0
  5  6  1  0
 24 25  2  0
 10 11  1  0
 25 26  1  0
 11 12  2  0
 26 27  2  0
 27 22  1  0
 12 13  1  0
  7 28  1  0
 13  9  2  0
 28 29  1  0
  7 10  1  0
 29 30  1  0
  5 14  1  0
 30 31  1  0
 30 32  2  0
 14 15  1  0
 31 33  1  0
  1  2  2  0
  6 34  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA215699

   Methyl 3-(11-benzyl-13-methyl-10-oxo-4-phenyl-5,6,8,11,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,12-pentaen-7-yl)propanoate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 453.50

Molecular Weight (Monoisotopic): 453.1801

AlogP: 3.57

#Rotatable Bonds: 6

Polar Surface Area: 91.38

Molecular Species: NEUTRAL

HBA: 8

HBD: ┄

#RO5 Violations: ┄

HBA (Lipinski): 8

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 3.63

CX LogD: 3.63

Aromatic Rings: 5

Heavy Atoms: 34

QED Weighted: 0.37

Np Likeness Score: -1.33

References

1. Giovannoni MP, Vergelli C, Biancalani C, Cesari N, Graziano A, Biagini P, Gracia J, Gavaldà A, Dal Piaz V..  (2006)  Novel pyrazolopyrimidopyridazinones with potent and selective phosphodiesterase 5 (PDE5) inhibitory activity as potential agents for treatment of erectile dysfunction.,  49  (17): [PMID:16913726] [10.1021/jm060265+]

Source

Source(1):

• Scientific Literature