5-(7-benzyl-9-methyl-6-oxo-2-phenyl-6,7-dihydro-3,3a,5,7,8-pentaaza-cyclopenta[a]naphthalen-4-yl)-pentanoic acid methyl ester

ID: ALA215756

PubChem CID: 11850083

Max Phase: Preclinical

Molecular Formula: C28H27N5O3

Molecular Weight: 481.56

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COC(=O)CCCCc1nc2c(=O)n(Cc3ccccc3)nc(C)c2c2cc(-c3ccccc3)nn12

Standard InChI:  InChI=1S/C28H27N5O3/c1-19-26-23-17-22(21-13-7-4-8-14-21)31-33(23)24(15-9-10-16-25(34)36-2)29-27(26)28(35)32(30-19)18-20-11-5-3-6-12-20/h3-8,11-14,17H,9-10,15-16,18H2,1-2H3

Standard InChI Key:  GFDYIUKUGURPBI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   -0.3809  -17.7662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4468  -17.7661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8587  -17.0532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4545  -16.3436    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3771  -16.3399    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7968  -17.0533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3848  -19.1927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8006  -18.4797    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.8549  -18.4796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4445  -19.1916    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9950  -19.8006    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7472  -19.4689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6590  -18.6511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7877  -15.6226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3693  -14.9099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4547  -14.9199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8691  -14.2118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4624  -13.4936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3668  -13.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7814  -14.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6837  -17.0556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4577  -19.8806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4515  -20.7032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1649  -21.1187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8815  -20.7054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8802  -19.8761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1661  -19.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7978  -19.9085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6228  -19.9102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0319  -20.6222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8569  -20.6238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2698  -21.3397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0948  -21.3414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8539  -22.0538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5039  -22.0572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6179  -17.0518    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 16 17  1  0
  9  2  1  0
 17 18  2  0
  1  8  1  0
 18 19  1  0
  9 10  1  0
 19 20  2  0
 20 15  1  0
  1  6  1  0
  3 21  1  0
  2  3  1  0
 12 22  1  0
  3  4  2  0
 22 23  2  0
  4  5  1  0
 23 24  1  0
  5  6  1  0
 24 25  2  0
 10 11  1  0
 25 26  1  0
 11 12  2  0
 26 27  2  0
 27 22  1  0
 12 13  1  0
  7 28  1  0
 13  9  2  0
 28 29  1  0
  7 10  1  0
 29 30  1  0
  5 14  1  0
 30 31  1  0
 31 32  1  0
 14 15  1  0
 32 33  1  0
  1  2  2  0
 32 34  2  0
 15 16  2  0
 33 35  1  0
  7  8  2  0
  6 36  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA215756

   Methyl 5-(11-benzyl-13-methyl-10-oxo-4-phenyl-5,6,8,11,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,12-pentaen-7-yl)pentanoate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 481.56

Molecular Weight (Monoisotopic): 481.2114

AlogP: 4.35

#Rotatable Bonds: 8

Polar Surface Area: 91.38

Molecular Species: NEUTRAL

HBA: 8

HBD: ┄

#RO5 Violations: ┄

HBA (Lipinski): 8

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 4.52

CX LogD: 4.52

Aromatic Rings: 5

Heavy Atoms: 36

QED Weighted: 0.24

Np Likeness Score: -1.20

References

1. Giovannoni MP, Vergelli C, Biancalani C, Cesari N, Graziano A, Biagini P, Gracia J, Gavaldà A, Dal Piaz V..  (2006)  Novel pyrazolopyrimidopyridazinones with potent and selective phosphodiesterase 5 (PDE5) inhibitory activity as potential agents for treatment of erectile dysfunction.,  49  (17): [PMID:16913726] [10.1021/jm060265+]

Source

Source(1):

• Scientific Literature