The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Deacetyl-3-(10-m-iodobenzyloxyethyl)-7,8-dihydrophylloerythrin ID: ALA2158209
PubChem CID: 136147497
Max Phase: Preclinical
Molecular Formula: C40H41IN4O4
Molecular Weight: 768.70
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@H]1c2cc3[nH]c4c(c5nc(cc6[nH]c(cc(n2)[C@@H]1C)c(C(C)OCc1cccc(I)c1)c6C)C(C)=C5CCC(=O)O)CC(=O)c4c3C
Standard InChI: InChI=1S/C40H41IN4O4/c1-7-26-19(2)29-17-34-37(23(6)49-18-24-9-8-10-25(41)13-24)21(4)31(43-34)15-30-20(3)27(11-12-36(47)48)39(44-30)28-14-35(46)38-22(5)32(45-40(28)38)16-33(26)42-29/h8-10,13,15-17,19,23,26,43,45H,7,11-12,14,18H2,1-6H3,(H,47,48)/b29-17-,30-15-,31-15-,32-16-,33-16-,34-17-,39-28-/t19-,23?,26-/m1/s1
Standard InChI Key: YJLIRCWSGRVRKL-HYURTFTASA-N
Molfile:
RDKit 2D
49 55 0 0 0 0 0 0 0 0999 V2000
16.8727 -22.8568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6926 -22.9538 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.8519 -23.7589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1339 -24.1641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5279 -23.6015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4361 -23.0849 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2521 -22.9896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5953 -23.7371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5153 -22.1099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9849 -21.4306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8000 -21.3426 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9710 -20.5369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2527 -20.1287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6458 -20.6817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6421 -20.0878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3368 -20.5297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3918 -21.3470 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.1909 -21.5507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6328 -20.8518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1014 -20.2213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6177 -24.3255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9954 -24.2935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2723 -23.8901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7471 -25.0850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8308 -25.1065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6667 -22.2229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3041 -19.4219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4530 -20.8202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8952 -21.5190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8358 -20.5115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3484 -25.7490 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.4065 -23.8974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7161 -23.7588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1201 -24.9891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8280 -25.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8183 -26.2369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0964 -26.6389 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5262 -26.6556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2526 -19.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5398 -18.8892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9696 -18.8891 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9695 -18.0683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6813 -17.6469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3991 -18.0556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1146 -17.6390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1044 -16.8108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3818 -16.4008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6731 -16.8236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8304 -18.0441 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
9 10 2 0
10 11 1 0
5 1 1 0
21 24 1 0
24 25 1 0
25 22 1 0
3 21 2 0
18 26 2 0
7 26 1 0
23 6 1 0
20 27 1 6
1 2 2 0
19 28 1 1
11 12 1 0
28 29 1 0
12 13 1 0
14 30 1 0
13 14 2 0
25 31 2 0
14 10 1 0
8 32 1 0
5 33 1 0
12 15 2 0
4 34 1 0
2 3 1 0
34 35 1 0
15 16 1 0
35 36 1 0
16 17 2 0
36 37 2 0
6 7 1 0
36 38 1 0
7 8 2 0
13 39 1 0
8 22 1 0
39 40 1 0
3 4 1 0
39 41 1 0
17 18 1 0
41 42 1 0
18 19 1 0
42 43 1 0
19 20 1 0
43 44 2 0
20 16 1 0
44 45 1 0
23 21 1 0
45 46 2 0
1 9 1 0
46 47 1 0
22 23 2 0
47 48 2 0
48 43 1 0
4 5 2 0
45 49 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 768.70Molecular Weight (Monoisotopic): 768.2173AlogP: 9.65#Rotatable Bonds: 8Polar Surface Area: 120.96Molecular Species: ACIDHBA: 5HBD: 3#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.02CX Basic pKa: 5.77CX LogP: 7.52CX LogD: 6.33Aromatic Rings: 4Heavy Atoms: 49QED Weighted: 0.15Np Likeness Score: 0.55
References 1. Srivatsan A, Wang Y, Joshi P, Sajjad M, Chen Y, Liu C, Thankppan K, Missert JR, Tracy E, Morgan J, Rigual N, Baumann H, Pandey RK.. (2011) In vitro cellular uptake and dimerization of signal transducer and activator of transcription-3 (STAT3) identify the photosensitizing and imaging-potential of isomeric photosensitizers derived from chlorophyll-a and bacteriochlorophyll-a., 54 (19): [PMID:21842893 ] [10.1021/jm200805y ]