The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[2-(2-{5-Fluoro-4-[4-((S)-2-hydroxy-propyl)-piperazin-1-yl]-2-methoxy-phenylamino}-pyrrolo[2,1-f][1,2,4]triazin-7-yl)-phenyl]-N-methylmethanesulfonamide ID: ALA2158521
PubChem CID: 56945491
Max Phase: Preclinical
Molecular Formula: C28H34FN7O4S
Molecular Weight: 583.69
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(N2CCN(C[C@H](C)O)CC2)c(F)cc1Nc1ncc2ccc(-c3ccccc3N(C)S(C)(=O)=O)n2n1
Standard InChI: InChI=1S/C28H34FN7O4S/c1-19(37)18-34-11-13-35(14-12-34)26-16-27(40-3)23(15-22(26)29)31-28-30-17-20-9-10-25(36(20)32-28)21-7-5-6-8-24(21)33(2)41(4,38)39/h5-10,15-17,19,37H,11-14,18H2,1-4H3,(H,31,32)/t19-/m0/s1
Standard InChI Key: ABDKJOVFIDLNSS-IBGZPJMESA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
-1.7014 -2.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7026 -3.0898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9878 -3.5027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2713 -3.0894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2742 -2.2588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9896 -1.8497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4438 -3.5007 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1576 -3.0871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8694 -3.4989 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8617 -1.8489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1513 -2.2642 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5819 -2.2601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5810 -3.0821 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3632 -3.3369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8464 -2.6724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3639 -2.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7623 -4.0569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3355 -4.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7346 -5.4854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5603 -5.5005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9853 -4.7884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5838 -4.0702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0070 -3.3619 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8319 -3.3743 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.2550 -2.6661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8250 -4.1958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6250 -3.5833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6052 -2.6414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4198 -1.8457 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4180 -1.0197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1285 -0.6075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8453 -1.0167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8471 -1.8426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1321 -2.2594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5583 -0.6016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2742 -1.0116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9872 -0.5966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2772 -1.8366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9880 -4.3277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7025 -4.7400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9920 -1.0247 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19 20 2 0
4 5 1 0
20 21 1 0
12 10 1 0
21 22 2 0
22 17 1 0
14 17 1 0
2 3 1 0
22 23 1 0
10 11 2 0
23 24 1 0
11 8 1 0
24 25 1 0
12 13 1 0
24 26 2 0
5 6 2 0
24 27 2 0
6 1 1 0
23 28 1 0
29 30 1 0
1 2 2 0
4 7 1 0
3 4 2 0
13 14 1 0
14 15 2 0
15 16 1 0
29 34 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
1 29 1 0
16 12 2 0
32 35 1 0
7 8 1 0
35 36 1 0
36 37 1 6
17 18 2 0
36 38 1 0
8 9 2 0
3 39 1 0
18 19 1 0
39 40 1 0
9 13 1 0
6 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 583.69Molecular Weight (Monoisotopic): 583.2377AlogP: 3.19#Rotatable Bonds: 9Polar Surface Area: 115.54Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.54CX Basic pKa: 7.30CX LogP: 2.75CX LogD: 2.49Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.31Np Likeness Score: -1.42
References 1. Mesaros EF, Thieu TV, Wells GJ, Zificsak CA, Wagner JC, Breslin HJ, Tripathy R, Diebold JL, McHugh RJ, Wohler AT, Quail MR, Wan W, Lu L, Huang Z, Albom MS, Angeles TS, Wells-Knecht KJ, Aimone LD, Cheng M, Ator MA, Ott GR, Dorsey BD.. (2012) Strategies to mitigate the bioactivation of 2-anilino-7-aryl-pyrrolo[2,1-f][1,2,4]triazines: identification of orally bioavailable, efficacious ALK inhibitors., 55 (1): [PMID:22141319 ] [10.1021/jm2010767 ]