N-[2-(2-{5-Fluoro-4-[4-((S)-2-hydroxy-propyl)-piperazin-1-yl]-2-methoxy-phenylamino}-pyrrolo[2,1-f][1,2,4]triazin-7-yl)-phenyl]-N-methylmethanesulfonamide

ID: ALA2158521

PubChem CID: 56945491

Max Phase: Preclinical

Molecular Formula: C28H34FN7O4S

Molecular Weight: 583.69

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(N2CCN(C[C@H](C)O)CC2)c(F)cc1Nc1ncc2ccc(-c3ccccc3N(C)S(C)(=O)=O)n2n1

Standard InChI:  InChI=1S/C28H34FN7O4S/c1-19(37)18-34-11-13-35(14-12-34)26-16-27(40-3)23(15-22(26)29)31-28-30-17-20-9-10-25(36(20)32-28)21-7-5-6-8-24(21)33(2)41(4,38)39/h5-10,15-17,19,37H,11-14,18H2,1-4H3,(H,31,32)/t19-/m0/s1

Standard InChI Key:  ABDKJOVFIDLNSS-IBGZPJMESA-N

Molfile:  

     RDKit          2D

 41 45  0  0  0  0  0  0  0  0999 V2000
   -1.7014   -2.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7026   -3.0898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9878   -3.5027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2713   -3.0894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2742   -2.2588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9896   -1.8497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4438   -3.5007    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1576   -3.0871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8694   -3.4989    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8617   -1.8489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1513   -2.2642    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5819   -2.2601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5810   -3.0821    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3632   -3.3369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8464   -2.6724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3639   -2.0070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7623   -4.0569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3355   -4.7642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7346   -5.4854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5603   -5.5005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9853   -4.7884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5838   -4.0702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0070   -3.3619    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8319   -3.3743    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.2550   -2.6661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8250   -4.1958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6250   -3.5833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6052   -2.6414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4198   -1.8457    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4180   -1.0197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1285   -0.6075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8453   -1.0167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8471   -1.8426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1321   -2.2594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5583   -0.6016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2742   -1.0116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9872   -0.5966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2772   -1.8366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9880   -4.3277    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7025   -4.7400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9920   -1.0247    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
 19 20  2  0
  4  5  1  0
 20 21  1  0
 12 10  1  0
 21 22  2  0
 22 17  1  0
 14 17  1  0
  2  3  1  0
 22 23  1  0
 10 11  2  0
 23 24  1  0
 11  8  1  0
 24 25  1  0
 12 13  1  0
 24 26  2  0
  5  6  2  0
 24 27  2  0
  6  1  1  0
 23 28  1  0
 29 30  1  0
  1  2  2  0
  4  7  1  0
  3  4  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 29 34  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
  1 29  1  0
 16 12  2  0
 32 35  1  0
  7  8  1  0
 35 36  1  0
 36 37  1  6
 17 18  2  0
 36 38  1  0
  8  9  2  0
  3 39  1  0
 18 19  1  0
 39 40  1  0
  9 13  1  0
  6 41  1  0
M  END

Associated Targets(Human)

ALK Tclin NPM/ALK (Nucleophosmin/ALK tyrosine kinase receptor) (119 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ALK Tclin ALK tyrosine kinase receptor (7132 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Liver microsomes (16955 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 583.69Molecular Weight (Monoisotopic): 583.2377AlogP: 3.19#Rotatable Bonds: 9
Polar Surface Area: 115.54Molecular Species: NEUTRALHBA: 10HBD: 2
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.54CX Basic pKa: 7.30CX LogP: 2.75CX LogD: 2.49
Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.31Np Likeness Score: -1.42

References

1. Mesaros EF, Thieu TV, Wells GJ, Zificsak CA, Wagner JC, Breslin HJ, Tripathy R, Diebold JL, McHugh RJ, Wohler AT, Quail MR, Wan W, Lu L, Huang Z, Albom MS, Angeles TS, Wells-Knecht KJ, Aimone LD, Cheng M, Ator MA, Ott GR, Dorsey BD..  (2012)  Strategies to mitigate the bioactivation of 2-anilino-7-aryl-pyrrolo[2,1-f][1,2,4]triazines: identification of orally bioavailable, efficacious ALK inhibitors.,  55  (1): [PMID:22141319] [10.1021/jm2010767]

Source