The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[2-(2-{4-[1-(2-Hydroxy-ethyl)-piperidin-4-yl]-2-methoxyhenylamino}-pyrrolo[2,1-f][1,2,4]triazin-7-yl)-phenyl]-N-methyl-methanesulfonamide ID: ALA2158525
PubChem CID: 56945493
Max Phase: Preclinical
Molecular Formula: C28H34N6O4S
Molecular Weight: 550.69
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C2CCN(CCO)CC2)ccc1Nc1ncc2ccc(-c3ccccc3N(C)S(C)(=O)=O)n2n1
Standard InChI: InChI=1S/C28H34N6O4S/c1-32(39(3,36)37)25-7-5-4-6-23(25)26-11-9-22-19-29-28(31-34(22)26)30-24-10-8-21(18-27(24)38-2)20-12-14-33(15-13-20)16-17-35/h4-11,18-20,35H,12-17H2,1-3H3,(H,30,31)
Standard InChI Key: SYZCXHIZVIOJHP-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
17.2402 -10.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2391 -11.1523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9539 -11.5652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6703 -11.1519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6675 -10.3213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9521 -9.9122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3855 -11.5632 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.0993 -11.1496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8110 -11.5614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.8034 -9.9114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0930 -10.3267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5235 -10.3226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5227 -11.1446 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3049 -11.3994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7881 -10.7349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3055 -10.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7040 -12.1194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2771 -12.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6762 -13.5479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5020 -13.5630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9270 -12.8509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5255 -12.1327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9486 -11.4244 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.7736 -11.4368 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
25.1967 -10.7286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7667 -12.2583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.5667 -11.6458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.5469 -10.7039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5218 -9.9082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5236 -9.0822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8132 -8.6700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0964 -9.0792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0946 -9.9051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8096 -10.3219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3834 -8.6641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6674 -9.0741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9544 -8.6591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9537 -12.3902 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2391 -12.8025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18 19 1 0
9 13 1 0
19 20 2 0
4 5 1 0
20 21 1 0
12 10 1 0
21 22 2 0
22 17 1 0
14 17 1 0
2 3 1 0
22 23 1 0
10 11 2 0
23 24 1 0
11 8 1 0
24 25 1 0
12 13 1 0
24 26 2 0
5 6 2 0
24 27 2 0
6 1 1 0
23 28 1 0
29 30 1 0
1 2 2 0
4 7 1 0
3 4 2 0
13 14 1 0
14 15 2 0
15 16 1 0
29 34 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
1 29 1 0
16 12 2 0
32 35 1 0
7 8 1 0
35 36 1 0
36 37 1 0
17 18 2 0
3 38 1 0
8 9 2 0
38 39 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 550.69Molecular Weight (Monoisotopic): 550.2362AlogP: 3.72#Rotatable Bonds: 9Polar Surface Area: 112.30Molecular Species: BASEHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.18CX Basic pKa: 8.89CX LogP: 2.72CX LogD: 1.22Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.32Np Likeness Score: -1.20
References 1. Mesaros EF, Thieu TV, Wells GJ, Zificsak CA, Wagner JC, Breslin HJ, Tripathy R, Diebold JL, McHugh RJ, Wohler AT, Quail MR, Wan W, Lu L, Huang Z, Albom MS, Angeles TS, Wells-Knecht KJ, Aimone LD, Cheng M, Ator MA, Ott GR, Dorsey BD.. (2012) Strategies to mitigate the bioactivation of 2-anilino-7-aryl-pyrrolo[2,1-f][1,2,4]triazines: identification of orally bioavailable, efficacious ALK inhibitors., 55 (1): [PMID:22141319 ] [10.1021/jm2010767 ]