The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-{2-[2-(2-Methoxy-4-piperidin-4-yl-phenylamino)-pyrrolo-[2,1-f][1,2,4]triazin-7-yl]-phenyl}-N-methyl-methanesulfonamide ID: ALA2158527
PubChem CID: 56945495
Max Phase: Preclinical
Molecular Formula: C26H30N6O3S
Molecular Weight: 506.63
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C2CCNCC2)ccc1Nc1ncc2ccc(-c3ccccc3N(C)S(C)(=O)=O)n2n1
Standard InChI: InChI=1S/C26H30N6O3S/c1-31(36(3,33)34)23-7-5-4-6-21(23)24-11-9-20-17-28-26(30-32(20)24)29-22-10-8-19(16-25(22)35-2)18-12-14-27-15-13-18/h4-11,16-18,27H,12-15H2,1-3H3,(H,29,30)
Standard InChI Key: FXEXWMOKUBELTG-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
7.5616 -16.1052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5604 -16.9327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2753 -17.3456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9918 -16.9322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9889 -16.1016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2735 -15.6925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7070 -17.3436 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4208 -16.9300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1327 -17.3418 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1250 -15.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4145 -16.1070 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8452 -16.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8443 -16.9250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6266 -17.1797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1098 -16.5151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6273 -15.8497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0257 -17.8998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5989 -18.6072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9980 -19.3284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8238 -19.3435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2488 -18.6314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8473 -17.9130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2705 -17.2048 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0954 -17.2172 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.5186 -16.5089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0885 -18.0387 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8886 -17.4262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8687 -16.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8432 -15.6885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8450 -14.8624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1344 -14.4502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4176 -14.8593 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4158 -15.6854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1308 -16.1022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2751 -18.1707 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5605 -18.5830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17 18 2 0
8 9 2 0
18 19 1 0
9 13 1 0
19 20 2 0
4 5 1 0
20 21 1 0
12 10 1 0
21 22 2 0
22 17 1 0
14 17 1 0
2 3 1 0
22 23 1 0
10 11 2 0
23 24 1 0
11 8 1 0
24 25 1 0
12 13 1 0
24 26 2 0
5 6 2 0
24 27 2 0
6 1 1 0
23 28 1 0
29 30 1 0
1 2 2 0
4 7 1 0
3 4 2 0
13 14 1 0
14 15 2 0
15 16 1 0
29 34 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
1 29 1 0
16 12 2 0
3 35 1 0
7 8 1 0
35 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 506.63Molecular Weight (Monoisotopic): 506.2100AlogP: 4.01#Rotatable Bonds: 7Polar Surface Area: 100.86Molecular Species: BASEHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.20CX Basic pKa: 10.06CX LogP: 3.03CX LogD: 0.45Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.39Np Likeness Score: -1.02
References 1. Mesaros EF, Thieu TV, Wells GJ, Zificsak CA, Wagner JC, Breslin HJ, Tripathy R, Diebold JL, McHugh RJ, Wohler AT, Quail MR, Wan W, Lu L, Huang Z, Albom MS, Angeles TS, Wells-Knecht KJ, Aimone LD, Cheng M, Ator MA, Ott GR, Dorsey BD.. (2012) Strategies to mitigate the bioactivation of 2-anilino-7-aryl-pyrrolo[2,1-f][1,2,4]triazines: identification of orally bioavailable, efficacious ALK inhibitors., 55 (1): [PMID:22141319 ] [10.1021/jm2010767 ]