The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-({(2R)-1-[4-(3-Buten-1-ylamino)-6-({[2-(2-thienyl)-1,3-thiazol-4-yl]methyl}amino)-1,3,5-triazin-2-yl]-2-pyrrolidinyl}-methyl)-4-(trifluoromethyl)benzenesulfonamide ID: ALA2164120
PubChem CID: 66559934
Max Phase: Preclinical
Molecular Formula: C27H29F3N8O2S3
Molecular Weight: 650.78
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=CCCNc1nc(NCc2csc(-c3cccs3)n2)nc(N2CCC[C@@H]2CNS(=O)(=O)c2ccc(C(F)(F)F)cc2)n1
Standard InChI: InChI=1S/C27H29F3N8O2S3/c1-2-3-12-31-24-35-25(32-15-19-17-42-23(34-19)22-7-5-14-41-22)37-26(36-24)38-13-4-6-20(38)16-33-43(39,40)21-10-8-18(9-11-21)27(28,29)30/h2,5,7-11,14,17,20,33H,1,3-4,6,12-13,15-16H2,(H2,31,32,35,36,37)/t20-/m1/s1
Standard InChI Key: ZDDSIQGYVHATQX-HXUWFJFHSA-N
Molfile:
RDKit 2D
43 47 0 0 0 0 0 0 0 0999 V2000
11.6442 -4.9946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0997 -6.5436 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.5732 -5.8824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0857 -5.2193 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3087 -5.4763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3148 -6.2969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3978 -5.8772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8853 -6.5362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6664 -6.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6612 -5.4546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8763 -5.2079 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.5387 -2.9176 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2668 -2.5313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9640 -2.9715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8100 -5.1522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3931 -4.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5725 -4.4506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1649 -5.1654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5819 -5.8741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4064 -5.8670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6296 -5.1420 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.0496 -4.4362 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3443 -5.1715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8716 -4.4330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0821 -5.3605 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2900 -5.1438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8376 -5.8242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3499 -6.4676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1168 -6.1787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8101 -4.1371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7973 -4.9598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5026 -5.3804 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2222 -4.9780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2311 -4.1569 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5242 -3.7366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9274 -5.3986 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9304 -4.4628 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.9411 -5.8864 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.5253 -5.1712 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.4149 -5.9308 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3394 -5.5470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6909 -2.5901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3867 -3.0253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
2 6 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
7 11 1 0
3 7 1 0
1 5 1 0
12 13 1 0
13 14 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
15 20 2 0
21 22 1 0
15 21 1 0
18 23 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
25 29 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
30 35 2 0
35 12 1 0
33 36 1 0
25 31 1 0
26 24 1 6
22 24 1 0
23 37 1 0
23 38 1 0
23 39 1 0
21 40 2 0
21 41 2 0
14 42 1 0
42 43 2 0
36 1 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 650.78Molecular Weight (Monoisotopic): 650.1528AlogP: 5.62#Rotatable Bonds: 13Polar Surface Area: 125.03Molecular Species: BASEHBA: 11HBD: 3#RO5 Violations: 3HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.14CX Basic pKa: 8.76CX LogP: 5.98CX LogD: 4.91Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.12Np Likeness Score: -1.74
References 1. Deng H, O'Keefe H, Davie CP, Lind KE, Acharya RA, Franklin GJ, Larkin J, Matico R, Neeb M, Thompson MM, Lohr T, Gross JW, Centrella PA, O'Donovan GK, Bedard KL, van Vloten K, Mataruse S, Skinner SR, Belyanskaya SL, Carpenter TY, Shearer TW, Clark MA, Cuozzo JW, Arico-Muendel CC, Morgan BA.. (2012) Discovery of highly potent and selective small molecule ADAMTS-5 inhibitors that inhibit human cartilage degradation via encoded library technology (ELT)., 55 (16): [PMID:22891645 ] [10.1021/jm300449x ]