The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-Methyl-2-(2-fluorobenzyl)-7-benzyloxy-9-benzyl-beta-carbolin-2-ium bromide ID: ALA2164717
PubChem CID: 54766733
Max Phase: Preclinical
Molecular Formula: C33H28BrFN2O
Molecular Weight: 487.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c2c(cc[n+]1Cc1ccccc1F)c1ccc(OCc3ccccc3)cc1n2Cc1ccccc1.[Br-]
Standard InChI: InChI=1S/C33H28FN2O.BrH/c1-24-33-30(18-19-35(24)22-27-14-8-9-15-31(27)34)29-17-16-28(37-23-26-12-6-3-7-13-26)20-32(29)36(33)21-25-10-4-2-5-11-25;/h2-20H,21-23H2,1H3;1H/q+1;/p-1
Standard InChI Key: QFZTVBUSKCUSJG-UHFFFAOYSA-M
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
8.6611 -17.3883 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
4.3115 -18.5059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3103 -19.3332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0253 -19.7462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0235 -18.0930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7388 -18.5022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7391 -19.3287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5262 -19.5830 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5249 -18.2466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0091 -18.9131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8264 -18.8262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1606 -18.0737 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6713 -17.4067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8557 -17.4970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5955 -19.7453 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3123 -19.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8812 -19.3321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1665 -19.7441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4509 -19.3324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7365 -19.7437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7354 -20.5696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4546 -20.9827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1660 -20.5689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9853 -18.0519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4166 -18.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0213 -19.4770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4519 -20.1799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2775 -20.1586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6707 -19.4285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2379 -18.7285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9185 -20.3088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4862 -21.0115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6610 -20.9834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2287 -21.6851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6211 -22.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4501 -22.4325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8788 -21.7300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6278 -18.0014 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 7 2 0
6 5 2 0
5 2 1 0
6 7 1 0
7 8 1 0
8 10 1 0
9 6 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
3 15 1 0
11 16 1 0
15 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
12 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
8 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
30 38 1 0
M CHG 2 1 -1 12 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 487.60Molecular Weight (Monoisotopic): 487.2180AlogP: 7.21#Rotatable Bonds: 7Polar Surface Area: 18.04Molecular Species: NEUTRALHBA: 2HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.98CX LogD: 2.98Aromatic Rings: 6Heavy Atoms: 37QED Weighted: 0.22Np Likeness Score: -0.53
References 1. Frédérick R, Bruyère C, Vancraeynest C, Reniers J, Meinguet C, Pochet L, Backlund A, Masereel B, Kiss R, Wouters J.. (2012) Novel trisubstituted harmine derivatives with original in vitro anticancer activity., 55 (14): [PMID:22770529 ] [10.1021/jm300542e ] 2. Meinguet C, Bruyère C, Frédérick R, Mathieu V, Vancraeynest C, Pochet L, Laloy J, Mortier J, Wolber G, Kiss R, Masereel B, Wouters J.. (2015) 3D-QSAR, design, synthesis and characterization of trisubstituted harmine derivatives with in vitro antiproliferative properties., 94 [PMID:25747498 ] [10.1016/j.ejmech.2015.02.044 ]