1-Methyl-2-(4-fluorobenzyl)-7-benzyloxy-9-benzyl-beta-carbolin-2-ium bromide

ID: ALA2164718

PubChem CID: 54766731

Max Phase: Preclinical

Molecular Formula: C33H28BrFN2O

Molecular Weight: 487.60

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c2c(cc[n+]1Cc1ccc(F)cc1)c1ccc(OCc3ccccc3)cc1n2Cc1ccccc1.[Br-]

Standard InChI:  InChI=1S/C33H28FN2O.BrH/c1-24-33-31(18-19-35(24)21-26-12-14-28(34)15-13-26)30-17-16-29(37-23-27-10-6-3-7-11-27)20-32(30)36(33)22-25-8-4-2-5-9-25;/h2-20H,21-23H2,1H3;1H/q+1;/p-1

Standard InChI Key:  HDGXFFZEDXJLJV-UHFFFAOYSA-M

Molfile:  

     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   21.3212  -18.2470    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   16.9618  -19.3509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9607  -20.1782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6755  -20.5912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6737  -18.9380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3892  -19.3472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3894  -20.1737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1765  -20.4280    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.1751  -19.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6594  -19.7581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4767  -19.6713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8108  -18.9186    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.3216  -18.2518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5059  -18.3421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2459  -20.5902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9624  -20.3381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5317  -20.1771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8168  -20.5891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1013  -20.1774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3870  -20.5886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3859  -21.4146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1052  -21.8275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8165  -21.4139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6356  -18.8969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0668  -19.6003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6715  -20.3220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1020  -21.0249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9277  -21.0036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3209  -20.2734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8881  -19.5735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5688  -21.1537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1364  -21.8564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3113  -21.8282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8791  -22.5300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2714  -23.2568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1005  -23.2774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5290  -22.5748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3598  -21.7064    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  7  2  0
  6  5  2  0
  5  2  1  0
  6  7  1  0
  7  8  1  0
  8 10  1  0
  9  6  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  3 15  1  0
 11 16  1  0
 15 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 12 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
  8 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 28 38  1  0
M  CHG  2   1  -1  12   1
M  END

Associated Targets(Human)

OE33 (225 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Hs 683 (377 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
T98G (1524 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 487.60Molecular Weight (Monoisotopic): 487.2180AlogP: 7.21#Rotatable Bonds: 7
Polar Surface Area: 18.04Molecular Species: NEUTRALHBA: 2HBD:
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 2.98CX LogD: 2.98
Aromatic Rings: 6Heavy Atoms: 37QED Weighted: 0.22Np Likeness Score: -0.50

References

1. Frédérick R, Bruyère C, Vancraeynest C, Reniers J, Meinguet C, Pochet L, Backlund A, Masereel B, Kiss R, Wouters J..  (2012)  Novel trisubstituted harmine derivatives with original in vitro anticancer activity.,  55  (14): [PMID:22770529] [10.1021/jm300542e]
2. Meinguet C, Bruyère C, Frédérick R, Mathieu V, Vancraeynest C, Pochet L, Laloy J, Mortier J, Wolber G, Kiss R, Masereel B, Wouters J..  (2015)  3D-QSAR, design, synthesis and characterization of trisubstituted harmine derivatives with in vitro antiproliferative properties.,  94  [PMID:25747498] [10.1016/j.ejmech.2015.02.044]

Source