3'-O-methyldehydroisopenicillide

ID: ALA2164948

PubChem CID: 9864866

Max Phase: Preclinical

Molecular Formula: C22H24O6

Molecular Weight: 384.43

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: 3'-O-Methyldehydroisopenicillide | 3'-O-Methyldehydroisopenicillide|CHEMBL2164948|CHEBI:215003|6-hydroxy-1-methoxy-2-[(E)-3-methoxy-3-methylbut-1-enyl]-8-methyl-10H-benzo[b][1,5]benzodioxocin-12-one

Canonical SMILES:  COc1c(/C=C/C(C)(C)OC)ccc2c1C(=O)OCc1cc(C)cc(O)c1O2

Standard InChI:  InChI=1S/C22H24O6/c1-13-10-15-12-27-21(24)18-17(28-19(15)16(23)11-13)7-6-14(20(18)25-4)8-9-22(2,3)26-5/h6-11,23H,12H2,1-5H3/b9-8+

Standard InChI Key:  JZRZUVUPQOWUMF-CMDGGOBGSA-N

Molfile:  

     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
    3.0418  -22.0394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4545  -22.7493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8629  -22.0369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5786  -23.1578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5775  -23.9774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2855  -24.3863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2837  -22.7490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5712  -22.5694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3983  -22.5653    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9829  -23.1441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9923  -23.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9965  -23.9811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5813  -24.5601    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9872  -23.9711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4061  -24.5528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6197  -25.3448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4140  -25.5563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9945  -24.9696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7778  -24.1798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2547  -21.8159    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2813  -21.9318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5723  -21.5253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7850  -25.1766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0428  -25.9236    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8708  -22.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1632  -23.1582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7478  -23.1585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0400  -22.7501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6 12  2  0
 11  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
  8 11  1  0
 11 12  1  0
 12 13  1  0
 13 15  1  0
 14 10  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
  8 20  2  0
  7 21  1  0
 21 22  1  0
 18 23  1  0
 16 24  1  0
  4 25  1  0
 25 26  2  0
 26  2  1  0
  2 27  1  0
 27 28  1  0
M  END

Alternative Forms

Associated Targets(non-human)

Artemia (698 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 384.43Molecular Weight (Monoisotopic): 384.1573AlogP: 4.61#Rotatable Bonds: 4
Polar Surface Area: 74.22Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.40CX Basic pKa: CX LogP: 4.26CX LogD: 4.22
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.78Np Likeness Score: 1.50

References

1. Zhang Y, Li XM, Shang Z, Li CS, Ji NY, Wang BG..  (2012)  Meroterpenoid and diphenyl ether derivatives from Penicillium sp. MA-37, a fungus isolated from marine mangrove rhizospheric soil.,  75  (11): [PMID:23148724] [10.1021/np300377b]

Source