KNPQLR

ID: ALA2165267

PubChem CID: 71455134

Max Phase: Preclinical

Molecular Formula: C32H58N12O9

Molecular Weight: 754.89

Molecule Type: Protein

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)C[C@H](NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC(N)=O)NC(=O)[C@@H](N)CCCCN)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O

Standard InChI:  InChI=1S/C32H58N12O9/c1-17(2)15-21(28(49)41-20(31(52)53)8-5-13-39-32(37)38)42-27(48)19(10-11-24(35)45)40-29(50)23-9-6-14-44(23)30(51)22(16-25(36)46)43-26(47)18(34)7-3-4-12-33/h17-23H,3-16,33-34H2,1-2H3,(H2,35,45)(H2,36,46)(H,40,50)(H,41,49)(H,42,48)(H,43,47)(H,52,53)(H4,37,38,39)/t18-,19-,20-,21-,22-,23-/m0/s1

Standard InChI Key:  WOPXTMYICCIEQV-LLINQDLYSA-N

Molfile:  

     RDKit          2D

 53 53  0  0  0  0  0  0  0  0999 V2000
   17.7923   -1.7938    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.7320   -2.6166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3456   -3.8996    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.4101   -3.0851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9896   -2.9712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9294   -3.7941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1828   -4.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1225   -4.9715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3843   -5.3302    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.1525   -2.7221    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.8304   -3.1822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2467   -3.2919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5687   -2.8277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7701   -4.0051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4440   -4.4651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3837   -5.2880    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.1947   -4.1148    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.6373   -2.0090    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.2871   -1.5349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0186   -2.7282    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.0186   -1.9032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2863   -0.7023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9970   -1.3738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3898   -0.5704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7264   -1.4948    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.4425   -1.9032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7264   -3.1407    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.4425   -2.7282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1587   -1.4948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8625   -1.9032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5828   -1.4948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5828   -0.6698    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.2864   -1.9032    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.1587   -3.1407    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.1587   -3.9615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5828   -3.9615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.8625   -4.3740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4425   -4.3740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4425   -5.1948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7264   -5.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1587   -5.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4267   -5.6073    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.1387   -5.1948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8506   -5.6073    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.1387   -4.3740    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.8625   -5.1948    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.5828   -5.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8625   -6.8448    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.5828   -6.4323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2864   -5.1948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0026   -5.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7146   -5.1948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2864   -6.8448    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  4 10  1  0
 13 18  1  0
 21 25  1  0
 28 34  1  0
 37 46  1  0
 49 53  1  0
  2  1  1  6
  2  4  1  0
  4  3  2  0
  2  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
 10 11  1  0
 11 13  1  0
 13 12  2  0
 11 14  1  6
 14 15  1  0
 15 16  2  0
 15 17  1  0
 18 19  1  0
 19 21  1  1
 21 20  2  0
 19 22  1  0
 23 24  1  0
 24 22  1  0
 23 18  1  0
 26 25  1  1
 26 28  1  0
 28 27  2  0
 26 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  2  0
 31 33  1  0
 35 34  1  6
 35 37  1  0
 37 36  2  0
 35 38  1  0
 38 39  1  0
 39 40  1  0
 39 41  1  0
 42 43  1  0
 43 44  1  0
 43 45  2  0
 47 46  1  1
 47 49  1  0
 49 48  2  0
 47 50  1  0
 50 51  1  0
 51 52  1  0
 52 42  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

FASN Tchem Fatty acid synthase (3390 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

FASN Fatty acid synthase (19 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 754.89Molecular Weight (Monoisotopic): 754.4450AlogP: -4.09#Rotatable Bonds: 25
Polar Surface Area: 374.13Molecular Species: ZWITTERIONHBA: 11HBD: 12
#RO5 Violations: 3HBA (Lipinski): 21HBD (Lipinski): 17#RO5 Violations (Lipinski): 3
CX Acidic pKa: 4.07CX Basic pKa: 13.57CX LogP: -7.17CX LogD: -10.44
Aromatic Rings: Heavy Atoms: 53QED Weighted: 0.02Np Likeness Score: 0.22

References

1. Abramson HN..  (2011)  The lipogenesis pathway as a cancer target.,  54  (16): [PMID:21726077] [10.1021/jm2005805]
2. and Abramson, Hanley N HN.  2011-08-25  The lipogenesis pathway as a cancer target.  [PMID:21726077]
3. and Abdel-Magid, Ahmed F AF.  2015-08-13  Fatty Acid Synthase (FASN) Inhibitors as Potential Treatment for Cancer, Obesity, and Liver Related Disorders.  [PMID:26288680]
4. Mullen, Genevieve E GE and Yet, Larry L.  2015-10-15  Progress in the development of fatty acid synthase inhibitors as anticancer targets.  [PMID:26364942]
5. Zhu, Mingzhao and 19 more authors.  2017-06-01  A strategy for dual inhibition of the proteasome and fatty acid synthase with belactosin C-orlistat hybrids.  [PMID:28236510]

Source