The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,3-dipropyl-8-[2-(5,6-exo-epoxy-(1S,2S)-norborn-2-yl)]-xanthine ID: ALA216750
PubChem CID: 44417680
Max Phase: Preclinical
Molecular Formula: C18H24N4O3
Molecular Weight: 344.42
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCn1c(=O)c2nc([C@H]3CC4C[C@@H]3[C@H]3O[C@@H]43)[nH]c2n(CCC)c1=O
Standard InChI: InChI=1S/C18H24N4O3/c1-3-5-21-16-12(17(23)22(6-4-2)18(21)24)19-15(20-16)11-8-9-7-10(11)14-13(9)25-14/h9-11,13-14H,3-8H2,1-2H3,(H,19,20)/t9?,10-,11-,13-,14+/m0/s1
Standard InChI Key: OQCJPFYWFGUHIN-KAELQNTISA-N
Molfile:
RDKit 2D
28 32 0 0 1 0 0 0 0 0999 V2000
15.2763 -3.2224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0840 -3.8243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1425 -2.5411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9409 -3.6111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6942 -4.1336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6933 -4.9641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0221 -5.4511 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1086 -6.2413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2807 -6.2385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8695 -6.9520 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2791 -7.6712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1111 -7.6698 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5252 -6.9534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8679 -8.3884 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.3512 -6.9501 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0393 -6.9560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6285 -6.2385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8057 -6.2382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5223 -8.3870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3524 -8.3868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7633 -7.6694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3610 -5.4531 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4362 -4.1503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7413 -3.5986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1109 -3.6102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4309 -2.6480 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
14.7137 -3.1896 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
15.0825 -4.8243 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5 2 1 0
6 7 1 0
7 9 1 0
5 6 1 6
8 9 2 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
11 14 2 0
13 15 2 0
10 16 1 0
16 17 1 0
17 18 1 0
12 19 1 0
19 20 1 0
20 21 1 0
8 22 1 0
22 6 2 0
24 23 1 0
24 25 1 0
23 25 1 0
24 1 1 0
23 2 1 0
2 3 1 0
3 1 1 0
1 4 1 0
4 5 1 0
24 26 1 6
23 27 1 6
2 28 1 6
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 344.42Molecular Weight (Monoisotopic): 344.1848AlogP: 1.60#Rotatable Bonds: 5Polar Surface Area: 85.21Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.53CX Basic pKa: 2.57CX LogP: 1.71CX LogD: 1.68Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.83Np Likeness Score: -0.02
References 1. Kiesman WF, Zhao J, Conlon PR, Dowling JE, Petter RC, Lutterodt F, Jin X, Smits G, Fure M, Jayaraj A, Kim J, Sullivan G, Linden J.. (2006) Potent and orally bioavailable 8-bicyclo[2.2.2]octylxanthines as adenosine A1 receptor antagonists., 49 (24): [PMID:17125264 ] [10.1021/jm0605381 ]