(R)-5-(4-Chlorophenyl)-4-(3-(4-(4-(4-(4-(4-hydroxypiperidin-1-yl)-1-(phenylthio)butan-2-ylamino)-3-(trifluoromethylsulfonyl)-phenylsulfonamido)phenyl)piperazin-1-yl)phenyl)-1-isopropyl-2-methyl-1H-pyrrole-3-carboxylic acid

ID: ALA2170838

PubChem CID: 71458860

Max Phase: Preclinical

Molecular Formula: C53H58ClF3N6O7S3

Molecular Weight: 1079.73

Molecule Type: Small molecule

Associated Items:

Bioactivity Summary Target Summary Assay Summary

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES: Cc1c(C(=O)O)c(-c2cccc(N3CCN(c4ccc(NS(=O)(=O)c5ccc(N[C@H](CCN6CCC(O)CC6)CSc6ccccc6)c(S(=O)(=O)C(F)(F)F)c5)cc4)CC3)c2)c(-c2ccc(Cl)cc2)n1C(C)C

Standard InChI: InChI=1S/C53H58ClF3N6O7S3/c1-35(2)63-36(3)49(52(65)66)50(51(63)37-12-14-39(54)15-13-37)38-8-7-9-43(32-38)62-30-28-61(29-31-62)42-18-16-40(17-19-42)59-73(69,70)46-20-21-47(48(33-46)72(67,68)53(55,56)57)58-41(34-71-45-10-5-4-6-11-45)22-25-60-26-23-44(64)24-27-60/h4-21,32-33,35,41,44,58-59,64H,22-31,34H2,1-3H3,(H,65,66)/t41-/m1/s1

Standard InChI Key: PNAMBQGMTWMVBZ-VQJSHJPSSA-N

Molfile:

     RDKit          2D

 73 80  0  0  0  0  0  0  0  0999 V2000
   17.6274  -15.4895    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2229  -14.7837    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.8140  -15.4869    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.8172  -12.3239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.6344  -12.3280    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.2294  -11.6183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9355  -13.5579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9344  -14.3774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6424  -14.7864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3521  -14.3770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3492  -13.5543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6406  -13.1490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3447  -11.9212    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.0536  -12.3276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0539  -13.1422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7620  -13.5486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4694  -13.1378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4644  -12.3164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7557  -11.9137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1753  -13.5413    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.1768  -14.3594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8822  -14.7649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5906  -14.3567    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.5890  -13.5386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8791  -13.1286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2956  -14.7631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2947  -15.5814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0018  -15.9895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7102  -15.5805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7072  -14.7591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9995  -14.3546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4107  -14.3449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1585  -14.6742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7029  -14.0647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2914  -13.3586    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.4928  -13.5319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8854  -12.9914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0535  -12.1906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4448  -11.6465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6677  -11.9021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5028  -12.7068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1128  -13.2473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0574  -11.3586    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   28.5159  -14.1468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3317  -15.4728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7267  -16.0221    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.1099  -15.7222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5190  -14.3763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8109  -14.7844    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.5196  -13.5591    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.8073  -13.9665    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.6422  -15.6036    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.3498  -16.0124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3496  -16.8296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0576  -15.6039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7652  -16.0127    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.7650  -16.8299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0572  -17.2341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0567  -18.0505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7648  -18.4601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4750  -18.0473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4720  -17.2322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6418  -17.2380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6416  -18.0552    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.9351  -18.4619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9330  -19.2756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6388  -19.6881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3484  -19.2809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3522  -18.4612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6355  -20.5053    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.6207  -12.6107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4330  -12.5219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1376  -11.9516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  4  2  0
  6  5  2  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 12  5  1  0
  5 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 20 21  1  0
 20 25  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 17 20  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 23 26  1  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  1  0
 36 32  2  0
 30 32  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 40 41  1  0
 41 42  2  0
 42 37  1  0
 36 37  1  0
 40 43  1  0
 34 44  1  0
 33 45  1  0
 45 46  2  0
 45 47  1  0
  8  2  1  0
  2 48  1  0
 48 49  1  0
 48 50  1  0
 48 51  1  0
  9 52  1  0
 52 53  1  0
 53 54  1  1
 53 55  1  0
 55 56  1  0
 56 57  1  0
 57 58  2  0
 58 59  1  0
 59 60  2  0
 60 61  1  0
 61 62  2  0
 62 57  1  0
 54 63  1  0
 63 64  1  0
 64 65  1  0
 64 69  1  0
 65 66  1  0
 66 67  1  0
 67 68  1  0
 68 69  1  0
 67 70  1  0
 35 71  1  0
 71 72  1  0
 71 73  1  0
M  END

Associated Targets(Human)

NCI-H146 (92 Activities)

Explore this target

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

NCI-H1417 (138 Activities)

Explore this target

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

MCL1 Tchem Induced myeloid leukemia cell differentiation protein Mcl-1 (3820 Activities)

Discover Target: MCL1

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

BCL2 Tclin Apoptosis regulator Bcl-2 (3787 Activities)

Discover Target: BCL2

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

Natural Product: No	Oral: No	Chemical Probe: No	Parenteral: No
Molecule Type: Small molecule	Topical: No	First In Class: No	Black Box: No
Chirality: No	Availability: No	Prodrug: No

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 1079.73	Molecular Weight (Monoisotopic): 1078.3170	AlogP: ┄	#Rotatable Bonds: ┄
Polar Surface Area: ┄	Molecular Species: ┄	HBA: ┄	HBD: ┄
#RO5 Violations: ┄	HBA (Lipinski): ┄	HBD (Lipinski): ┄	#RO5 Violations (Lipinski): ┄
CX Acidic pKa: ┄	CX Basic pKa: ┄	CX LogP: ┄	CX LogD: ┄
Aromatic Rings: ┄	Heavy Atoms: ┄	QED Weighted: ┄	Np Likeness Score: ┄

References

1. Chen J, Zhou H, Aguilar A, Liu L, Bai L, McEachern D, Yang CY, Meagher JL, Stuckey JA, Wang S.. (2012) Structure-based discovery of BM-957 as a potent small-molecule inhibitor of Bcl-2 and Bcl-xL capable of achieving complete tumor regression., 55 (19): [PMID:23030453] [10.1021/jm3010306]

(R)-5-(4-Chlorophenyl)-4-(3-(4-(4-(4-(4-(4-hydroxypiperidin-1-yl)-1-(phenylthio)butan-2-ylamino)-3-(trifluoromethylsulfonyl)-phenylsulfonamido)phenyl)piperazin-1-yl)phenyl)-1-isopropyl-2-methyl-1H-pyrrole-3-carboxylic acid

Names and Identifiers

Alternative Forms

Associated Targets(Human)

Associated Targets(non-human)

Molecule Features

Drug Indications

Mechanisms of Action

Calculated Properties

References

Source