(R)-5-(4-Chlorophenyl)-1,2-dimethyl-4-(3-(4-(4-(4-(1-(phenylthio)-4-(pyrrolidin-1-yl)butan-2-ylamino)-3-(trifluoromethylsulfonyl)phenylsulfonamido)phenyl)piperazin-1-yl)-phenyl)-1H-pyrrole-3-carboxylic acid

ID: ALA2170849

PubChem CID: 71455206

Max Phase: Preclinical

Molecular Formula: C50H52ClF3N6O6S3

Molecular Weight: 1021.65

Molecule Type: Small molecule

Associated Items:

Bioactivity Summary Target Summary Assay Summary

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES: Cc1c(C(=O)O)c(-c2cccc(N3CCN(c4ccc(NS(=O)(=O)c5ccc(N[C@H](CCN6CCCC6)CSc6ccccc6)c(S(=O)(=O)C(F)(F)F)c5)cc4)CC3)c2)c(-c2ccc(Cl)cc2)n1C

Standard InChI: InChI=1S/C50H52ClF3N6O6S3/c1-34-46(49(61)62)47(48(57(34)2)35-13-15-37(51)16-14-35)36-9-8-10-41(31-36)60-29-27-59(28-30-60)40-19-17-38(18-20-40)56-69(65,66)43-21-22-44(45(32-43)68(63,64)50(52,53)54)55-39(23-26-58-24-6-7-25-58)33-67-42-11-4-3-5-12-42/h3-5,8-22,31-32,39,55-56H,6-7,23-30,33H2,1-2H3,(H,61,62)/t39-/m1/s1

Standard InChI Key: QFEVODPERDFEPA-LDLOPFEMSA-N

Molfile:

     RDKit          2D

 69 76  0  0  0  0  0  0  0  0999 V2000
   17.7801  -15.6876    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3756  -14.9818    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.9667  -15.6850    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9700  -12.5220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7871  -12.5261    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.3821  -11.8164    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.0882  -13.7560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0871  -14.5756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7951  -14.9845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5048  -14.5751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5020  -13.7524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7933  -13.3472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4974  -12.1193    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.2063  -12.5257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2066  -13.3403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9147  -13.7467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6221  -13.3359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6171  -12.5145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9084  -12.1118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3280  -13.7394    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.3296  -14.5575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0350  -14.9630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7433  -14.5548    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.7417  -13.7367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0318  -13.3267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4483  -14.9612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4474  -15.7795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1545  -16.1876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8629  -15.7786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8599  -14.9572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1522  -14.5527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5634  -14.5430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3113  -14.8723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8556  -14.2628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4441  -13.5567    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.6455  -13.7300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0381  -13.1895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2062  -12.3887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5975  -11.8446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8204  -12.1002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6555  -12.9049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2655  -13.4455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2101  -11.5567    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   27.7734  -12.8088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6687  -14.3449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4844  -15.6709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8794  -16.2202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.2626  -15.9203    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6717  -14.5744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9636  -14.9825    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.6723  -13.7572    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.9600  -14.1646    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.7949  -15.8017    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.5025  -16.2105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5023  -17.0277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2103  -15.8021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9180  -16.2108    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.9178  -17.0280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2099  -17.4322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2094  -18.2486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9175  -18.6582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6277  -18.2454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6247  -17.4303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7945  -17.4361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7943  -18.2533    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.1376  -18.7338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3899  -19.5111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2072  -19.5113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4597  -18.7341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  4  2  0
  6  5  2  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 12  5  1  0
  5 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 20 21  1  0
 20 25  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 17 20  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 23 26  1  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  1  0
 36 32  2  0
 30 32  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 40 41  1  0
 41 42  2  0
 42 37  1  0
 36 37  1  0
 40 43  1  0
 35 44  1  0
 34 45  1  0
 33 46  1  0
 46 47  2  0
 46 48  1  0
  8  2  1  0
  2 49  1  0
 49 50  1  0
 49 51  1  0
 49 52  1  0
  9 53  1  0
 53 54  1  0
 54 55  1  1
 54 56  1  0
 56 57  1  0
 57 58  1  0
 58 59  2  0
 59 60  1  0
 60 61  2  0
 61 62  1  0
 62 63  2  0
 63 58  1  0
 55 64  1  0
 64 65  1  0
 65 66  1  0
 66 67  1  0
 67 68  1  0
 68 69  1  0
 69 65  1  0
M  END

Associated Targets(Human)

NCI-H1417 (138 Activities)

Explore this target

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

BCL2 Tclin Apoptosis regulator Bcl-2 (3787 Activities)

Discover Target: BCL2

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

Natural Product: No	Oral: No	Chemical Probe: No	Parenteral: No
Molecule Type: Small molecule	Topical: No	First In Class: No	Black Box: No
Chirality: No	Availability: No	Prodrug: No

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 1021.65	Molecular Weight (Monoisotopic): 1020.2751	AlogP: ┄	#Rotatable Bonds: ┄
Polar Surface Area: ┄	Molecular Species: ┄	HBA: ┄	HBD: ┄
#RO5 Violations: ┄	HBA (Lipinski): ┄	HBD (Lipinski): ┄	#RO5 Violations (Lipinski): ┄
CX Acidic pKa: ┄	CX Basic pKa: ┄	CX LogP: ┄	CX LogD: ┄
Aromatic Rings: ┄	Heavy Atoms: ┄	QED Weighted: ┄	Np Likeness Score: ┄

References

1. Chen J, Zhou H, Aguilar A, Liu L, Bai L, McEachern D, Yang CY, Meagher JL, Stuckey JA, Wang S.. (2012) Structure-based discovery of BM-957 as a potent small-molecule inhibitor of Bcl-2 and Bcl-xL capable of achieving complete tumor regression., 55 (19): [PMID:23030453] [10.1021/jm3010306]

(R)-5-(4-Chlorophenyl)-1,2-dimethyl-4-(3-(4-(4-(4-(1-(phenylthio)-4-(pyrrolidin-1-yl)butan-2-ylamino)-3-(trifluoromethylsulfonyl)phenylsulfonamido)phenyl)piperazin-1-yl)-phenyl)-1H-pyrrole-3-carboxylic acid

Names and Identifiers

Alternative Forms

Associated Targets(Human)

Molecule Features

Drug Indications

Mechanisms of Action

Calculated Properties

References

Source