(R)-5-(4-Chlorophenyl)-4-(3-(4-(4-(4-(4-(3-hydroxyazetidin-1-yl)-1-(phenylthio)butan-2-ylamino)-3-(trifluoromethylsulfonyl)-phenylsulfonamido)phenyl)piperazin-1-yl)phenyl)-1,2-dimethyl-1Hpyrrole-3-carboxylic acid

ID: ALA2170851

PubChem CID: 71451662

Max Phase: Preclinical

Molecular Formula: C49H50ClF3N6O7S3

Molecular Weight: 1023.62

Molecule Type: Small molecule

Associated Items:

Bioactivity Summary Target Summary Assay Summary

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES: Cc1c(C(=O)O)c(-c2cccc(N3CCN(c4ccc(NS(=O)(=O)c5ccc(N[C@H](CCN6CC(O)C6)CSc6ccccc6)c(S(=O)(=O)C(F)(F)F)c5)cc4)CC3)c2)c(-c2ccc(Cl)cc2)n1C

Standard InChI: InChI=1S/C49H50ClF3N6O7S3/c1-32-45(48(61)62)46(47(56(32)2)33-11-13-35(50)14-12-33)34-7-6-8-39(27-34)59-25-23-58(24-26-59)38-17-15-36(16-18-38)55-69(65,66)42-19-20-43(44(28-42)68(63,64)49(51,52)53)54-37(21-22-57-29-40(60)30-57)31-67-41-9-4-3-5-10-41/h3-20,27-28,37,40,54-55,60H,21-26,29-31H2,1-2H3,(H,61,62)/t37-/m1/s1

Standard InChI Key: AWZSYBDJTXIAFX-DIPNUNPCSA-N

Molfile:

     RDKit          2D

 69 76  0  0  0  0  0  0  0  0999 V2000
   17.8090  -25.6672    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4045  -24.9615    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.9956  -25.6646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9988  -22.5017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8160  -22.5058    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.4110  -21.7960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.1171  -23.7357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1160  -24.5552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8240  -24.9642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5337  -24.5547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5308  -23.7321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8222  -23.3268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5263  -22.0989    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.2352  -22.5054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2355  -23.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9436  -23.7263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6510  -23.3156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6460  -22.4942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9373  -22.0914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3569  -23.7190    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.3584  -24.5371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0638  -24.9426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7722  -24.5344    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.7706  -23.7163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0607  -23.3063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4772  -24.9408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4763  -25.7591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1834  -26.1672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8918  -25.7582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8888  -24.9368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1811  -24.5324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5923  -24.5226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3401  -24.8519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8845  -24.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4730  -23.5363    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.6744  -23.7096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0670  -23.1692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2351  -22.3683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6264  -21.8243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8493  -22.0798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6844  -22.8845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2944  -23.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2390  -21.5364    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   27.8023  -22.7884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6975  -24.3246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5133  -25.6506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9083  -26.1999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.2915  -25.8999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.7006  -24.5541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9925  -24.9621    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.7012  -23.7369    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.9889  -24.1443    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.8238  -25.7813    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.5314  -26.1901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5312  -27.0073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2392  -25.7817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9468  -26.1905    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.9466  -27.0077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2388  -27.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2383  -28.2282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9464  -28.6378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6566  -28.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6536  -27.4099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8234  -27.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8232  -28.2329    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2449  -28.8061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8226  -29.3841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4006  -28.8064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8224  -30.2013    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  4  2  0
  6  5  2  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 12  5  1  0
  5 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 20 21  1  0
 20 25  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 17 20  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 23 26  1  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  1  0
 36 32  2  0
 30 32  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 40 41  1  0
 41 42  2  0
 42 37  1  0
 36 37  1  0
 40 43  1  0
 35 44  1  0
 34 45  1  0
 33 46  1  0
 46 47  2  0
 46 48  1  0
  8  2  1  0
  2 49  1  0
 49 50  1  0
 49 51  1  0
 49 52  1  0
  9 53  1  0
 53 54  1  0
 54 55  1  1
 54 56  1  0
 56 57  1  0
 57 58  1  0
 58 59  2  0
 59 60  1  0
 60 61  2  0
 61 62  1  0
 62 63  2  0
 63 58  1  0
 55 64  1  0
 64 65  1  0
 65 66  1  0
 66 67  1  0
 67 68  1  0
 68 65  1  0
 67 69  1  0
M  END

Associated Targets(Human)

NCI-H1417 (138 Activities)

Explore this target

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

BCL2 Tclin Apoptosis regulator Bcl-2 (3787 Activities)

Discover Target: BCL2

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

Natural Product: No	Oral: No	Chemical Probe: No	Parenteral: No
Molecule Type: Small molecule	Topical: No	First In Class: No	Black Box: No
Chirality: No	Availability: No	Prodrug: No

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 1023.62	Molecular Weight (Monoisotopic): 1022.2544	AlogP: ┄	#Rotatable Bonds: ┄
Polar Surface Area: ┄	Molecular Species: ┄	HBA: ┄	HBD: ┄
#RO5 Violations: ┄	HBA (Lipinski): ┄	HBD (Lipinski): ┄	#RO5 Violations (Lipinski): ┄
CX Acidic pKa: ┄	CX Basic pKa: ┄	CX LogP: ┄	CX LogD: ┄
Aromatic Rings: ┄	Heavy Atoms: ┄	QED Weighted: ┄	Np Likeness Score: ┄

References

1. Chen J, Zhou H, Aguilar A, Liu L, Bai L, McEachern D, Yang CY, Meagher JL, Stuckey JA, Wang S.. (2012) Structure-based discovery of BM-957 as a potent small-molecule inhibitor of Bcl-2 and Bcl-xL capable of achieving complete tumor regression., 55 (19): [PMID:23030453] [10.1021/jm3010306]

(R)-5-(4-Chlorophenyl)-4-(3-(4-(4-(4-(4-(3-hydroxyazetidin-1-yl)-1-(phenylthio)butan-2-ylamino)-3-(trifluoromethylsulfonyl)-phenylsulfonamido)phenyl)piperazin-1-yl)phenyl)-1,2-dimethyl-1Hpyrrole-3-carboxylic acid

Names and Identifiers

Alternative Forms

Associated Targets(Human)

Molecule Features

Drug Indications

Mechanisms of Action

Calculated Properties

References

Source