The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-butylcarbonyl-3-(4-imidazol-1-ylmethylphenyl)-5-iso-butylthiophene-2-sulfonamide ID: ALA217208
PubChem CID: 11994293
Max Phase: Preclinical
Molecular Formula: C23H29N3O3S2
Molecular Weight: 459.64
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCC(=O)NS(=O)(=O)c1sc(CC(C)C)cc1-c1ccc(Cn2ccnc2)cc1
Standard InChI: InChI=1S/C23H29N3O3S2/c1-4-5-6-22(27)25-31(28,29)23-21(14-20(30-23)13-17(2)3)19-9-7-18(8-10-19)15-26-12-11-24-16-26/h7-12,14,16-17H,4-6,13,15H2,1-3H3,(H,25,27)
Standard InChI Key: WELAFDZBRULMPT-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
-4.4723 -0.3458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4734 -1.1732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7586 -1.5860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0422 -1.1727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0450 -0.3422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7604 0.0670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7583 -2.4081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4269 -2.8920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1720 -3.6776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3458 -3.6765 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.0930 -2.8902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7629 0.8920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0496 1.3066 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2950 0.9769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7441 1.5922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1604 2.3058 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.9672 2.1291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3089 -2.6335 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.6000 -2.2167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9695 -3.3855 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6452 -1.8802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8822 -2.6234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1711 -2.2052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8756 -3.4484 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5466 -2.6120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2578 -2.1938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9755 -2.6006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6566 -4.3452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4771 -4.2594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9618 -4.9270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8130 -3.5058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 4 2 0
13 14 1 0
15 16 1 0
16 17 2 0
17 13 1 0
4 5 1 0
11 18 1 0
2 3 1 0
18 19 1 0
7 8 1 0
18 20 2 0
9 10 1 0
18 21 2 0
10 11 1 0
19 22 1 0
11 7 2 0
22 23 1 0
3 7 1 0
22 24 2 0
5 6 2 0
23 25 1 0
6 12 1 0
25 26 1 0
6 1 1 0
26 27 1 0
12 13 1 0
9 28 1 0
14 15 2 0
28 29 1 0
8 9 2 0
29 30 1 0
1 2 2 0
29 31 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 459.64Molecular Weight (Monoisotopic): 459.1650AlogP: 4.85#Rotatable Bonds: 10Polar Surface Area: 81.06Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.66CX Basic pKa: 6.54CX LogP: 4.68CX LogD: 4.49Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.47Np Likeness Score: -0.97
References 1. Wu X, Wan Y, Mahalingam AK, Murugaiah AM, Plouffe B, Botros M, Karlén A, Hallberg M, Gallo-Payet N, Alterman M.. (2006) Selective angiotensin II AT2 receptor agonists: arylbenzylimidazole structure-activity relationships., 49 (24): [PMID:17125268 ] [10.1021/jm0606185 ]