3-[5-(4-Methoxyphenyl)-3-naphthalen-2-ylpyrazol-1-yl]-2,3-dihydro-1H-indol-2-one

ID: ALA2172550

PubChem CID: 71460763

Max Phase: Preclinical

Molecular Formula: C28H21N3O2

Molecular Weight: 431.50

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2cc(-c3ccc4ccccc4c3)nn2C2C(=O)Nc3ccccc32)cc1

Standard InChI:  InChI=1S/C28H21N3O2/c1-33-22-14-12-19(13-15-22)26-17-25(21-11-10-18-6-2-3-7-20(18)16-21)30-31(26)27-23-8-4-5-9-24(23)29-28(27)32/h2-17,27H,1H3,(H,29,32)

Standard InChI Key:  VKTQOARRBBJLOE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 38  0  0  0  0  0  0  0  0999 V2000
    4.6255   -8.9400    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2882   -8.4485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9603   -8.9269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7131   -9.7140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1325  -10.4244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7270  -11.1429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9020  -11.1509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4826  -10.4405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8881   -9.7221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2801   -7.6236    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7424   -8.6644    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4146   -9.1427    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0772   -8.6513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8147   -7.8692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9897   -7.8773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4720   -8.3406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8643   -8.8986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0437   -9.7039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8308   -9.9511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4385   -9.3931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2255   -9.6404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8332   -9.0824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6538   -8.2772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8667   -8.0299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2591   -8.5879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4983   -7.2146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8265   -6.4577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3351   -5.7950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5155   -5.8893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1873   -6.6462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6787   -7.3088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0241   -5.2266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3522   -4.4697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  1  9  1  0
  4  9  2  0
  2 10  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 11 15  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 16 25  2  0
 20 25  1  0
 13 17  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 26 31  2  0
 32 33  1  0
 29 32  1  0
 15 26  1  0
  3 11  1  0
M  END

Associated Targets(Human)

OVCAR-4 (44535 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 431.50Molecular Weight (Monoisotopic): 431.1634AlogP: 5.92#Rotatable Bonds: 4
Polar Surface Area: 56.15Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.14CX Basic pKa: 2.25CX LogP: 5.71CX LogD: 5.71
Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.38Np Likeness Score: -0.62

References

1. Havrylyuk D, Zimenkovsky B, Vasylenko O, Gzella A, Lesyk R..  (2012)  Synthesis of new 4-thiazolidinone-, pyrazoline-, and isatin-based conjugates with promising antitumor activity.,  55  (20): [PMID:22992049] [10.1021/jm300789g]

Source