The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-[5-(4-Methoxyphenyl)-3-naphthalen-2-ylpyrazol-1-yl]-2,3-dihydro-1H-indol-2-one ID: ALA2172550
PubChem CID: 71460763
Max Phase: Preclinical
Molecular Formula: C28H21N3O2
Molecular Weight: 431.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2cc(-c3ccc4ccccc4c3)nn2C2C(=O)Nc3ccccc32)cc1
Standard InChI: InChI=1S/C28H21N3O2/c1-33-22-14-12-19(13-15-22)26-17-25(21-11-10-18-6-2-3-7-20(18)16-21)30-31(26)27-23-8-4-5-9-24(23)29-28(27)32/h2-17,27H,1H3,(H,29,32)
Standard InChI Key: VKTQOARRBBJLOE-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 38 0 0 0 0 0 0 0 0999 V2000
4.6255 -8.9400 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2882 -8.4485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9603 -8.9269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7131 -9.7140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1325 -10.4244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7270 -11.1429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9020 -11.1509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4826 -10.4405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8881 -9.7221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2801 -7.6236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7424 -8.6644 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4146 -9.1427 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0772 -8.6513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8147 -7.8692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9897 -7.8773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4720 -8.3406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8643 -8.8986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0437 -9.7039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8308 -9.9511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4385 -9.3931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2255 -9.6404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8332 -9.0824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6538 -8.2772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8667 -8.0299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2591 -8.5879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4983 -7.2146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8265 -6.4577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3351 -5.7950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5155 -5.8893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1873 -6.6462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6787 -7.3088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0241 -5.2266 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3522 -4.4697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
1 9 1 0
4 9 2 0
2 10 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
11 15 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
16 25 2 0
20 25 1 0
13 17 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
26 31 2 0
32 33 1 0
29 32 1 0
15 26 1 0
3 11 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.50Molecular Weight (Monoisotopic): 431.1634AlogP: 5.92#Rotatable Bonds: 4Polar Surface Area: 56.15Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.14CX Basic pKa: 2.25CX LogP: 5.71CX LogD: 5.71Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.38Np Likeness Score: -0.62
References 1. Havrylyuk D, Zimenkovsky B, Vasylenko O, Gzella A, Lesyk R.. (2012) Synthesis of new 4-thiazolidinone-, pyrazoline-, and isatin-based conjugates with promising antitumor activity., 55 (20): [PMID:22992049 ] [10.1021/jm300789g ]