The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
{3-[5-(2-Hydroxyphenyl)-3-phenylpyrazol-1-yl]-2-oxo-2,3-dihydroindol-1-yl}acetic Acid ID: ALA2172759
PubChem CID: 136237413
Max Phase: Preclinical
Molecular Formula: C25H19N3O4
Molecular Weight: 425.44
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)CN1C(=O)C(n2nc(-c3ccccc3)cc2-c2ccccc2O)c2ccccc21
Standard InChI: InChI=1S/C25H19N3O4/c29-22-13-7-5-10-17(22)21-14-19(16-8-2-1-3-9-16)26-28(21)24-18-11-4-6-12-20(18)27(25(24)32)15-23(30)31/h1-14,24,29H,15H2,(H,30,31)
Standard InChI Key: PASUAPSWILNSJS-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
4.0779 -6.2241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6732 -5.6529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2749 -7.0252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2856 -5.9941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4524 -5.9241 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1298 -5.4531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7870 -5.9517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5159 -6.7309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9135 -7.4538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4862 -8.1595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6614 -8.1424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2638 -7.4196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6910 -6.7138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1469 -4.6283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5767 -5.7131 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2340 -6.2118 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9113 -5.7408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6727 -4.9510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8479 -4.9339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6905 -6.0119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8453 -6.8223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6244 -7.0934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2488 -6.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0941 -5.7439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3149 -5.4727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3769 -4.2566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7280 -3.5100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2570 -2.8327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4349 -2.9019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0838 -3.6485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5548 -4.3258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5501 -3.4408 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
5 13 1 0
8 13 2 0
6 14 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
15 19 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
20 25 2 0
17 20 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
26 31 2 0
27 32 1 0
19 26 1 0
7 15 1 0
2 5 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 425.44Molecular Weight (Monoisotopic): 425.1376AlogP: 3.94#Rotatable Bonds: 5Polar Surface Area: 95.66Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.70CX Basic pKa: 2.05CX LogP: 3.79CX LogD: 0.60Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.50Np Likeness Score: -0.68
References 1. Havrylyuk D, Zimenkovsky B, Vasylenko O, Gzella A, Lesyk R.. (2012) Synthesis of new 4-thiazolidinone-, pyrazoline-, and isatin-based conjugates with promising antitumor activity., 55 (20): [PMID:22992049 ] [10.1021/jm300789g ]