Neurokinin A

ID: ALA217406

Cas Number: 86933-74-6

PubChem CID: 5311311

Max Phase: Preclinical

Molecular Formula: C50H80N14O14S

Molecular Weight: 1133.34

Molecule Type: Protein

Names and Identifiers

Canonical SMILES:  CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CO)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)Cc1c[nH]cn1)[C@@H](C)O)C(C)C)C(N)=O

Standard InChI:  InChI=1S/C50H80N14O14S/c1-26(2)18-34(45(73)58-32(42(53)70)15-17-79-6)57-38(67)23-55-49(77)40(27(3)4)63-47(75)35(19-29-12-8-7-9-13-29)60-48(76)37(24-65)62-46(74)36(21-39(68)69)61-50(78)41(28(5)66)64-44(72)33(14-10-11-16-51)59-43(71)31(52)20-30-22-54-25-56-30/h7-9,12-13,22,25-28,31-37,40-41,65-66H,10-11,14-21,23-24,51-52H2,1-6H3,(H2,53,70)(H,54,56)(H,55,77)(H,57,67)(H,58,73)(H,59,71)(H,60,76)(H,61,78)(H,62,74)(H,63,75)(H,64,72)(H,68,69)/t28-,31+,32+,33+,34+,35+,36+,37+,40+,41+/m1/s1

Standard InChI Key:  HEAUFJZALFKPBA-JPQUDPSNSA-N

Molfile:  

     RDKit          2D

 79 80  0  0  1  0  0  0  0  0999 V2000
    0.5417   -2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2625   -2.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1708   -2.4667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4167   -2.4667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5542   -2.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7042   -2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8958   -2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4042   -2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1542   -2.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0375   -2.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1250   -2.4667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9750   -2.0542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8417   -2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2750   -2.0542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6917   -2.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8667   -2.0542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3208   -2.0542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1375   -2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6917   -3.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8542   -2.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9875   -2.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7333   -0.5375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4375   -2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3000   -2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7167   -2.4667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0375   -0.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9500    0.0083    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4042   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7583   -1.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0000   -2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5667   -2.0542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6083   -2.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7583   -2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5792   -2.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1458    0.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2833   -1.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2625   -3.2917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5542   -3.2917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7042   -1.2292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8958   -1.2292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4042   -1.2292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1542   -3.2917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0375   -3.2917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9875   -3.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8542   -3.2917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.3000   -1.2292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4375   -1.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5417   -1.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4042   -4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0000   -1.2292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2875   -2.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0167   -2.4667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1375   -1.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4708   -2.4667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5792   -3.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1250   -3.2917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7042   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3000   -4.5375    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.8417   -1.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1708   -5.7792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2625   -0.8167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5542   -0.8167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1542   -0.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3000   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6083   -3.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1708   -4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1708   -0.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0167   -4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8542   -0.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4167   -0.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4167   -3.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7042   -4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8958   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8958   -4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1542    0.0083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8667   -1.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4167   -4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1375   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1375   -4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  1  1
  4  6  1  0
  5 13  1  0
  6 21  1  0
  7  3  1  0
  8 15  1  0
  9 23  1  0
 10 17  1  0
 11  8  1  0
 12  2  1  0
 13 11  1  1
 14  5  1  0
 15 12  1  6
 16  9  1  0
 32 17  1  6
 18  4  1  1
 15 19  1  0
 20 18  1  0
 21 14  1  6
 22 36  1  0
 23 25  1  1
 24 34  1  0
 25 30  1  0
 26 29  1  0
 27 26  1  0
 28 19  1  0
 33 29  1  0
 30 51  1  0
 31 20  1  0
 32  7  1  0
 33 10  1  0
 34 16  1  6
 35 27  2  0
 36 26  2  0
 37  2  2  0
 38  5  2  0
 39  6  2  0
 40  7  2  0
 41  8  2  0
 42  9  2  0
 43 10  2  0
 21 44  1  0
 45 20  2  0
 46 24  2  0
 23 47  1  0
  1 48  1  0
 49 28  2  0
 50 30  2  0
 51 31  1  0
 52 24  1  0
 18 53  1  0
 33 54  1  1
 34 55  1  0
 56 28  1  0
 57 44  1  0
 58 64  1  0
 13 59  1  0
 60 66  1  0
 48 61  1  1
 62 59  1  0
 63 47  1  0
 64 55  1  0
 32 65  1  0
 66 74  1  0
 67 48  1  0
 68 58  1  0
 69 53  1  0
 70 53  1  0
 71 57  1  0
 72 57  2  0
 73 65  1  0
 74 73  1  0
 75 63  1  0
 76 63  1  0
 77 72  1  0
 78 71  2  0
 79 77  2  0
 35 22  1  0
 78 79  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA217406

   NEUROKININ A

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Protein

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 1133.34

Molecular Weight (Monoisotopic): 1132.5699

AlogP: ┄

#Rotatable Bonds: ┄

Polar Surface Area: ┄

Molecular Species: ┄

HBA: ┄

HBD: ┄

#RO5 Violations: ┄

HBA (Lipinski): ┄

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: ┄

CX LogD: ┄

Aromatic Rings: ┄

Heavy Atoms: ┄

QED Weighted: ┄

Np Likeness Score: ┄

References

1. Laufer R, Gilon C, Chorev M, Selinger Z..  (1986)  [pGlu6,Pro9]SP6-11, a selective agonist for the substance P P-receptor subtype.,  29  (7): [PMID:2433445] [10.1021/jm00157a029]

2. Harrison T, Korsgaard MP, Swain CJ, Cascieri MA, Sadowski S, Seabrook GR..  (1998)  High affinity, selective neurokinin 2 and neurokinin 3 receptor antagonists from a common structural template.,  8  (11): [PMID:9871763] [10.1016/s0960-894x(98)00215-7]

3. Karoyan P, Sagan S, Clodic G, Lavielle S, Chassaing G..  (1998)  Asymmetric synthesis of Boc-N-methyl-p-benzoyl-phenylalanine. Preparation of a photoreactive antagonist of substance P.,  8  (11): [PMID:9871768] [10.1016/s0960-894x(98)00219-4]

4. Neugebauer W, Elliott P, Cuello AC, Escher E..  (1988)  Synthesis and immunological evaluation of N-terminal, noncrossreactive tachykinin antigens.,  31  (10): [PMID:2459385] [10.1021/jm00118a007]

5. Gembitsky DS, Murnin M, Otvös FL, Allen J, Murphy RF, Lovas S..  (1999)  Importance of the aromatic residue at position 6 of [Nle(10)]neurokinin A(4-10) for binding to the NK-2 receptor and receptor activation.,  42  (15): [PMID:10425111] [10.1021/jm9807151]

6. Rosen T, Seeger TF, McLean S, Desai MC, Guarino KJ, Bryce D, Pratt K, Heym J, Chalabi PM, Windels JH..  (1993)  Synthesis, in vitro binding profile, and autoradiographic analysis of [3H]-cis-3-[(2-methoxybenzyl)amino]-2-phenylpiperidine, a highly potent and selective nonpeptide substance P receptor antagonist radioligand.,  36  (21): [PMID:7693945] [10.1021/jm00073a022]

7. Giolitti A, Altamura M, Bellucci F, Giannotti D, Meini S, Patacchini R, Rotondaro L, Zappitelli S, Maggi CA..  (2002)  Monocyclic human tachykinin NK-2 receptor antagonists as evolution of a potent bicyclic antagonist: QSAR and site-directed mutagenesis studies.,  45  (16): [PMID:12139452] [10.1021/jm011127h]

8. Harbeson SL, Shatzer SA, Le TB, Buck SH..  (1992)  A new class of high affinity ligands for the neurokinin A NK2 receptor: psi (CH2NR) reduced peptide bond analogues of neurokinin A4-10.,  35  (21): [PMID:1331450] [10.1021/jm00099a024]

9. Deal MJ, Hagan RM, Ireland SJ, Jordan CC, McElroy AB, Porter B, Ross BC, Stephens-Smith M, Ward P..  (1992)  Conformationally constrained tachykinin analogues: potent and highly selective neurokinin NK-2 receptor agonists.,  35  (22): [PMID:1331460] [10.1021/jm00100a027]

10. Wang J, Bray AM, DiPasquale AJ, Maeji N, Geysen H.  (1993)  Application of the multipin peptide synthesis technique for peptide receptor binding studies: Substance P as A model system,  3  (3): [10.1016/S0960-894X(01)80229-8]

11. Howson W, Hodgson J, Richardson R, Walton L, Guard S, Watling K.  (1992)  An SAR study for the non-peptide substance P receptor (NK1) antagonist, CP-96,345.,  2  (6): [10.1016/S0960-894X(01)81197-5]

12. Singh P, Hurrell CR, Findlay JB, Fishwick CW.  (1997)  Two novel amino acid derivatives containing side-chain thioamides for the synthesis of photoactivatable peptides,  7  (6): [10.1016/S0960-894X(97)00088-7]

13. Valant C, Maillet E, Bourguignon JJ, Bucher B, Utard V, Galzi JL, Hibert M..  (2009)  Allosteric functional switch of neurokinin A-mediated signaling at the neurokinin NK2 receptor: structural exploration.,  52  (19): [PMID:19746979] [10.1021/jm900671k]

14. Ma Z, Du L, Li M..  (2014)  Toward fluorescent probes for G-protein-coupled receptors (GPCRs).,  57  (20): [PMID:24983484] [10.1021/jm401823z]

Source

Source(1):

• Scientific Literature