The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-((4-aminobutylamino)methyl)phenoxy)anthracene-1,4-dione bis(trifluoroacetate salt ID: ALA2177124
PubChem CID: 71457243
Max Phase: Preclinical
Molecular Formula: C27H25F3N2O5
Molecular Weight: 400.48
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NCCCCNCc1ccc(OC2=CC(=O)c3cc4ccccc4cc3C2=O)cc1.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C25H24N2O3.C2HF3O2/c26-11-3-4-12-27-16-17-7-9-20(10-8-17)30-24-15-23(28)21-13-18-5-1-2-6-19(18)14-22(21)25(24)29;3-2(4,5)1(6)7/h1-2,5-10,13-15,27H,3-4,11-12,16,26H2;(H,6,7)
Standard InChI Key: RRKAFODIXVPONT-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
5.6750 -10.0187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3830 -9.6100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0909 -10.0187 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3830 -8.7925 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9671 -9.6100 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.6750 -10.8361 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.8824 -10.2292 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.3900 -11.4670 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6721 -11.8710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9632 -11.4514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2454 -11.8554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5366 -11.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8187 -11.8399 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8198 -10.2847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5392 -10.6966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8198 -11.9405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5392 -11.5287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2543 -11.9405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9736 -11.5287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9736 -10.6966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2543 -10.2847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1042 -10.7007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1006 -11.5287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3829 -11.9377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6684 -11.5198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6760 -10.6887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3944 -10.2835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4016 -9.4598 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3782 -12.7614 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9667 -10.2701 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2493 -10.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2436 -11.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5271 -11.9014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8168 -11.4826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8273 -10.6547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5444 -10.2534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0988 -11.8867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
1 5 1 0
1 6 1 0
1 7 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
21 15 1 0
15 17 1 0
15 14 2 0
14 22 1 0
23 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
22 23 2 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 22 1 0
27 28 2 0
24 29 2 0
26 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
34 37 1 0
37 8 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 400.48Molecular Weight (Monoisotopic): 400.1787AlogP: 4.01#Rotatable Bonds: 8Polar Surface Area: 81.42Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 10.26CX LogP: 3.11CX LogD: -1.38Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.56Np Likeness Score: 0.34
References 1. Lizzi F, Veronesi G, Belluti F, Bergamini C, López-Sánchez A, Kaiser M, Brun R, Krauth-Siegel RL, Hall DG, Rivas L, Bolognesi ML.. (2012) Conjugation of quinones with natural polyamines: toward an expanded antitrypanosomatid profile., 55 (23): [PMID:23153330 ] [10.1021/jm301112z ]