The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-(2-(2-Aminopyridin-3-yl)-5-(pyridin-3-yl)-3H-imidazo-[4,5-b]pyridin-3-yl)phenyl)-N-phenylacetamide ID: ALA2177829
PubChem CID: 58344924
Max Phase: Preclinical
Molecular Formula: C30H23N7O
Molecular Weight: 497.56
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ncccc1-c1nc2ccc(-c3cccnc3)nc2n1-c1ccc(CC(=O)Nc2ccccc2)cc1
Standard InChI: InChI=1S/C30H23N7O/c31-28-24(9-5-17-33-28)29-36-26-15-14-25(21-6-4-16-32-19-21)35-30(26)37(29)23-12-10-20(11-13-23)18-27(38)34-22-7-2-1-3-8-22/h1-17,19H,18H2,(H2,31,33)(H,34,38)
Standard InChI Key: ZGLFXQWORRZAMQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
8.0632 -8.7744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0620 -9.5940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7701 -10.0030 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7683 -8.3656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4769 -8.7709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4817 -9.5895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2617 -9.8379 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7391 -9.1728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2540 -8.5134 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6734 -10.5383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2679 -11.2490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6806 -11.9535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4986 -11.9484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9022 -11.2330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4872 -10.5314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5543 -9.1675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9665 -9.8744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7829 -9.8699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1881 -9.1593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7710 -8.4517 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9559 -8.4596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5412 -7.7555 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9129 -12.6528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7301 -12.6462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1444 -13.3505 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1330 -11.9352 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7415 -14.0615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9234 -14.0646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5206 -14.7748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9349 -15.4801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7563 -15.4709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1554 -14.7601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3559 -10.0023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6482 -9.5914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9407 -9.9988 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9396 -10.8169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6520 -11.2259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3566 -10.8161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
7 10 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
8 16 1 0
21 22 1 0
13 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
25 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
2 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 497.56Molecular Weight (Monoisotopic): 497.1964AlogP: 5.31#Rotatable Bonds: 6Polar Surface Area: 111.61Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.98CX Basic pKa: 5.90CX LogP: 4.75CX LogD: 4.74Aromatic Rings: 6Heavy Atoms: 38QED Weighted: 0.32Np Likeness Score: -1.46
References 1. Ashwell MA, Lapierre JM, Brassard C, Bresciano K, Bull C, Cornell-Kennon S, Eathiraj S, France DS, Hall T, Hill J, Kelleher E, Khanapurkar S, Kizer D, Koerner S, Link J, Liu Y, Makhija S, Moussa M, Namdev N, Nguyen K, Nicewonger R, Palma R, Szwaya J, Tandon M, Uppalapati U, Vensel D, Volak LP, Volckova E, Westlund N, Wu H, Yang RY, Chan TC.. (2012) Discovery and optimization of a series of 3-(3-phenyl-3H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amines: orally bioavailable, selective, and potent ATP-independent Akt inhibitors., 55 (11): [PMID:22533986 ] [10.1021/jm300276x ]