The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(5-(3-Acetamidophenyl)-2-(2-aminopyridin-3-yl)-3Himidazo[4,5-b]pyridin-3-yl)benzyl)benzamide ID: ALA2177834
PubChem CID: 58344941
Max Phase: Preclinical
Molecular Formula: C33H27N7O2
Molecular Weight: 553.63
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Nc1cccc(-c2ccc3nc(-c4cccnc4N)n(-c4ccc(CNC(=O)c5ccccc5)cc4)c3n2)c1
Standard InChI: InChI=1S/C33H27N7O2/c1-21(41)37-25-10-5-9-24(19-25)28-16-17-29-32(38-28)40(31(39-29)27-11-6-18-35-30(27)34)26-14-12-22(13-15-26)20-36-33(42)23-7-3-2-4-8-23/h2-19H,20H2,1H3,(H2,34,35)(H,36,42)(H,37,41)
Standard InChI Key: ODXGZMFSEOVGAX-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
17.1307 -19.2328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1296 -20.0524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8376 -20.4613 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.8358 -18.8240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5444 -19.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5492 -20.0479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3293 -20.2963 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.8066 -19.6312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3215 -18.9718 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7409 -20.9967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3354 -21.7074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7481 -22.4119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5662 -22.4068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9698 -21.6914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5548 -20.9898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6218 -19.6259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0340 -20.3328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8504 -20.3283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2556 -19.6177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8385 -18.9101 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0234 -18.9180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6087 -18.2139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9805 -23.1112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7976 -23.1046 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2119 -23.8089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8091 -24.5199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9909 -24.5230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5881 -25.2332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0025 -25.9385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8238 -25.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2229 -25.2185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0291 -23.8023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4234 -20.4607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7158 -20.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0082 -20.4572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0071 -21.2753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7195 -21.6842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4241 -21.2745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3010 -20.0477 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3021 -19.2305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5949 -18.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0103 -18.8228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
7 10 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
8 16 1 0
21 22 1 0
13 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
25 32 2 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
2 33 1 0
35 39 1 0
39 40 1 0
40 41 1 0
40 42 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 553.63Molecular Weight (Monoisotopic): 553.2226AlogP: 5.62#Rotatable Bonds: 7Polar Surface Area: 127.82Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 6.89CX LogP: 4.93CX LogD: 4.92Aromatic Rings: 6Heavy Atoms: 42QED Weighted: 0.24Np Likeness Score: -1.45
References 1. Ashwell MA, Lapierre JM, Brassard C, Bresciano K, Bull C, Cornell-Kennon S, Eathiraj S, France DS, Hall T, Hill J, Kelleher E, Khanapurkar S, Kizer D, Koerner S, Link J, Liu Y, Makhija S, Moussa M, Namdev N, Nguyen K, Nicewonger R, Palma R, Szwaya J, Tandon M, Uppalapati U, Vensel D, Volak LP, Volckova E, Westlund N, Wu H, Yang RY, Chan TC.. (2012) Discovery and optimization of a series of 3-(3-phenyl-3H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amines: orally bioavailable, selective, and potent ATP-independent Akt inhibitors., 55 (11): [PMID:22533986 ] [10.1021/jm300276x ]