The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(2-(2-Aminopyridin-3-yl)-5-phenyl-3H-imidazo[4,5-b]-pyridin-3-yl)benzyl)benzamide ID: ALA2177835
PubChem CID: 58345151
Max Phase: Preclinical
Molecular Formula: C31H24N6O
Molecular Weight: 496.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ncccc1-c1nc2ccc(-c3ccccc3)nc2n1-c1ccc(CNC(=O)c2ccccc2)cc1
Standard InChI: InChI=1S/C31H24N6O/c32-28-25(12-7-19-33-28)29-36-27-18-17-26(22-8-3-1-4-9-22)35-30(27)37(29)24-15-13-21(14-16-24)20-34-31(38)23-10-5-2-6-11-23/h1-19H,20H2,(H2,32,33)(H,34,38)
Standard InChI Key: AOMCLUHHIWNPGC-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
26.0785 -19.3236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0774 -20.1432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7854 -20.5521 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.7837 -18.9148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4923 -19.3200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4971 -20.1387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2771 -20.3871 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.7545 -19.7220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2693 -19.0626 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.6888 -21.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2833 -21.7982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6959 -22.5027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5140 -22.4976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9176 -21.7822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5026 -21.0806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5697 -19.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9818 -20.4236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7982 -20.4191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2035 -19.7085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7863 -19.0009 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.9713 -19.0088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5566 -18.3047 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.9283 -23.2020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7455 -23.1954 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.1598 -23.8997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7569 -24.6107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9387 -24.6138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5359 -25.3240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9503 -26.0293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7717 -26.0200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1707 -25.3093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9769 -23.8931 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.3713 -20.5515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6636 -20.1406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9560 -20.5480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9550 -21.3661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6673 -21.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3720 -21.3653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
7 10 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
8 16 1 0
21 22 1 0
13 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
25 32 2 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
2 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 496.57Molecular Weight (Monoisotopic): 496.2012AlogP: 5.66#Rotatable Bonds: 6Polar Surface Area: 98.72Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 5.89CX LogP: 5.70CX LogD: 5.68Aromatic Rings: 6Heavy Atoms: 38QED Weighted: 0.31Np Likeness Score: -1.26
References 1. Ashwell MA, Lapierre JM, Brassard C, Bresciano K, Bull C, Cornell-Kennon S, Eathiraj S, France DS, Hall T, Hill J, Kelleher E, Khanapurkar S, Kizer D, Koerner S, Link J, Liu Y, Makhija S, Moussa M, Namdev N, Nguyen K, Nicewonger R, Palma R, Szwaya J, Tandon M, Uppalapati U, Vensel D, Volak LP, Volckova E, Westlund N, Wu H, Yang RY, Chan TC.. (2012) Discovery and optimization of a series of 3-(3-phenyl-3H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amines: orally bioavailable, selective, and potent ATP-independent Akt inhibitors., 55 (11): [PMID:22533986 ] [10.1021/jm300276x ]