The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(5-(3-Acetamidophenyl)-2-(2-aminopyridin-3-yl)-3Himidazo[4,5-b]pyridin-3-yl)benzyl)-3-fluorobenzamide ID: ALA2177836
Cas Number: 1313880-28-2
PubChem CID: 56965952
Max Phase: Preclinical
Molecular Formula: C33H26FN7O2
Molecular Weight: 571.62
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Nc1cccc(-c2ccc3nc(-c4cccnc4N)n(-c4ccc(CNC(=O)c5cccc(F)c5)cc4)c3n2)c1
Standard InChI: InChI=1S/C33H26FN7O2/c1-20(42)38-25-8-3-5-22(18-25)28-14-15-29-32(39-28)41(31(40-29)27-9-4-16-36-30(27)35)26-12-10-21(11-13-26)19-37-33(43)23-6-2-7-24(34)17-23/h2-18H,19H2,1H3,(H2,35,36)(H,37,43)(H,38,42)
Standard InChI Key: WFDHLKUQFQCHKF-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 48 0 0 0 0 0 0 0 0999 V2000
2.4956 -26.8104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4944 -27.6300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2025 -28.0389 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2007 -26.4016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9093 -26.8068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9141 -27.6255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6941 -27.8739 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1715 -27.2088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6864 -26.5494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1058 -28.5743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7003 -29.2850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1130 -29.9895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9310 -29.9844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3346 -29.2690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9196 -28.5674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9867 -27.2035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3988 -27.9104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2153 -27.9059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6205 -27.1953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2033 -26.4877 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3883 -26.4956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9736 -25.7915 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3453 -30.6888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1625 -30.6822 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5768 -31.3865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1739 -32.0975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3557 -32.1006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9529 -32.8107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3673 -33.5161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1887 -33.5068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5878 -32.7961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3939 -31.3799 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7883 -28.0383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0806 -27.6274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3731 -28.0348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3720 -28.8528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0843 -29.2618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7890 -28.8521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3345 -27.6253 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3355 -26.8081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0481 -26.3986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3751 -26.4004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6055 -34.2098 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
7 10 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
8 16 1 0
21 22 1 0
13 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
25 32 2 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
2 33 1 0
35 39 1 0
39 40 1 0
40 41 1 0
40 42 2 0
30 43 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 571.62Molecular Weight (Monoisotopic): 571.2132AlogP: 5.76#Rotatable Bonds: 7Polar Surface Area: 127.82Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 6.89CX LogP: 5.08CX LogD: 5.06Aromatic Rings: 6Heavy Atoms: 43QED Weighted: 0.22Np Likeness Score: -1.67
References 1. Ashwell MA, Lapierre JM, Brassard C, Bresciano K, Bull C, Cornell-Kennon S, Eathiraj S, France DS, Hall T, Hill J, Kelleher E, Khanapurkar S, Kizer D, Koerner S, Link J, Liu Y, Makhija S, Moussa M, Namdev N, Nguyen K, Nicewonger R, Palma R, Szwaya J, Tandon M, Uppalapati U, Vensel D, Volak LP, Volckova E, Westlund N, Wu H, Yang RY, Chan TC.. (2012) Discovery and optimization of a series of 3-(3-phenyl-3H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amines: orally bioavailable, selective, and potent ATP-independent Akt inhibitors., 55 (11): [PMID:22533986 ] [10.1021/jm300276x ]