The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-((5-Aminopentylamino)methyl)phenoxy)anthracene-1,4-dione bis(Trifluoroacetate Salt) ID: ALA2179000
PubChem CID: 71455461
Max Phase: Preclinical
Molecular Formula: C28H27F3N2O5
Molecular Weight: 414.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NCCCCCNCc1ccc(OC2=CC(=O)c3cc4ccccc4cc3C2=O)cc1.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C26H26N2O3.C2HF3O2/c27-12-4-1-5-13-28-17-18-8-10-21(11-9-18)31-25-16-24(29)22-14-19-6-2-3-7-20(19)15-23(22)26(25)30;3-2(4,5)1(6)7/h2-3,6-11,14-16,28H,1,4-5,12-13,17,27H2;(H,6,7)
Standard InChI Key: RHHNWJCCBPASBZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 40 0 0 0 0 0 0 0 0999 V2000
22.5976 -9.2543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3056 -8.8455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0137 -9.2543 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3056 -8.0279 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.8895 -8.8455 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.5976 -10.0719 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.8047 -9.4649 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
24.1479 -10.6371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.4299 -11.0413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7208 -10.6216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0027 -11.0257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2938 -10.6060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5791 -9.4546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2985 -9.8666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5791 -11.1109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2985 -10.6989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0137 -11.1109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7333 -10.6989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7333 -9.8666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0137 -9.4546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8633 -9.8707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8597 -10.6989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1419 -11.1079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4272 -10.6900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4348 -9.8587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1534 -9.4534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1606 -8.6295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.1372 -11.9319 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.7253 -9.4399 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.0078 -9.8450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0020 -10.6665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2855 -11.0718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5749 -10.6527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5856 -9.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3028 -9.4234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8569 -11.0569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5758 -11.0101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8667 -10.5904 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
1 5 1 0
1 6 1 0
1 7 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
20 14 1 0
14 16 1 0
14 13 2 0
13 21 1 0
22 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
21 22 2 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 21 1 0
26 27 2 0
23 28 2 0
25 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
33 36 1 0
36 8 1 0
12 37 1 0
37 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 414.51Molecular Weight (Monoisotopic): 414.1943AlogP: 4.40#Rotatable Bonds: 9Polar Surface Area: 81.42Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 10.26CX LogP: 3.55CX LogD: -0.94Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.51Np Likeness Score: 0.37
References 1. Lizzi F, Veronesi G, Belluti F, Bergamini C, López-Sánchez A, Kaiser M, Brun R, Krauth-Siegel RL, Hall DG, Rivas L, Bolognesi ML.. (2012) Conjugation of quinones with natural polyamines: toward an expanded antitrypanosomatid profile., 55 (23): [PMID:23153330 ] [10.1021/jm301112z ]