The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-((3-(4-(3-aminopropylamino)butylamino)propylamino)methyl)phenoxy)naphthalene-1,4-dione tetrakis(trifluoroacetate salt) ID: ALA2179001
PubChem CID: 71450090
Max Phase: Preclinical
Molecular Formula: C29H37F3N4O5
Molecular Weight: 464.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NCCCNCCCCNCCCNCc1ccc(OC2=CC(=O)c3ccccc3C2=O)cc1.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C27H36N4O3.C2HF3O2/c28-13-5-16-29-14-3-4-15-30-17-6-18-31-20-21-9-11-22(12-10-21)34-26-19-25(32)23-7-1-2-8-24(23)27(26)33;3-2(4,5)1(6)7/h1-2,7-12,19,29-31H,3-6,13-18,20,28H2;(H,6,7)
Standard InChI Key: BQLQTJVXHKDLGS-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 42 0 0 0 0 0 0 0 0999 V2000
5.3492 -14.1406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0569 -13.7320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7646 -14.1406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0569 -12.9148 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6415 -13.7320 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.3492 -14.9578 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.5568 -14.3511 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.6639 -14.2624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3842 -14.6749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6639 -15.9207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3842 -15.5082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9472 -14.6791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9435 -15.5082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2248 -15.9179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5091 -15.4994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5169 -14.6671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2362 -14.2612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2435 -13.4363 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2201 -16.7428 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8064 -14.2478 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0880 -14.6533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0823 -15.4760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3648 -15.8816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6533 -15.4622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6639 -14.6329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3820 -14.2311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9344 -15.8668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2245 -15.4465 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5056 -15.8512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7957 -15.4309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0767 -15.8355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3667 -15.4152 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6478 -15.8200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9379 -15.3997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2190 -15.8043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5091 -15.3840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7901 -15.7887 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0802 -15.3684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3613 -15.7730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6514 -15.3528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0741 -15.7575 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
1 5 1 0
1 6 1 0
1 7 1 0
9 11 1 0
9 8 2 0
8 12 1 0
13 10 1 0
10 11 2 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 12 1 0
17 18 2 0
14 19 2 0
16 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.61Molecular Weight (Monoisotopic): 464.2787AlogP: 2.82#Rotatable Bonds: 16Polar Surface Area: 105.48Molecular Species: BASEHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 10.75CX LogP: 1.51CX LogD: -5.21Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.28Np Likeness Score: 0.25
References 1. Lizzi F, Veronesi G, Belluti F, Bergamini C, López-Sánchez A, Kaiser M, Brun R, Krauth-Siegel RL, Hall DG, Rivas L, Bolognesi ML.. (2012) Conjugation of quinones with natural polyamines: toward an expanded antitrypanosomatid profile., 55 (23): [PMID:23153330 ] [10.1021/jm301112z ]