The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
benzyl(2S,3R)-4-(N-benzyl-2-diazoacetamido)-3-hydroxy-1-phenylbutan-2-ylcarbamate ID: ALA2179952
PubChem CID: 86635877
Max Phase: Preclinical
Molecular Formula: C27H28N4O4
Molecular Weight: 472.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: [N-]=[N+]=CC(=O)N(Cc1ccccc1)C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1
Standard InChI: InChI=1S/C27H28N4O4/c28-29-17-26(33)31(18-22-12-6-2-7-13-22)19-25(32)24(16-21-10-4-1-5-11-21)30-27(34)35-20-23-14-8-3-9-15-23/h1-15,17,24-25,32H,16,18-20H2,(H,30,34)/t24-,25+/m0/s1
Standard InChI Key: YELDMMOUQWGLJX-LOSJGSFVSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
0.9027 -10.9706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9015 -11.7980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6164 -12.2109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3328 -11.7975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3299 -10.9670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6146 -10.5578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0428 -10.5518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7588 -10.9616 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4717 -10.5464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1877 -10.9562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4686 -9.7214 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9006 -10.5410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6166 -10.9509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6197 -11.7758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8975 -9.7160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6105 -9.3009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3240 -9.7150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0364 -9.3006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0338 -8.4747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3127 -8.0651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6033 -8.4819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3295 -10.5356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0456 -10.9454 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7584 -10.5303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4745 -10.9401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7553 -9.7053 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0486 -11.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7647 -12.1802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7627 -13.0051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4778 -13.4147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1917 -12.9995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1859 -12.1703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4702 -11.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1873 -10.5248 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8998 -10.1082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
12 10 1 0
12 13 1 0
13 14 1 1
12 15 1 1
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
13 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
23 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
25 34 2 0
34 35 2 0
M CHG 2 34 1 35 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 472.55Molecular Weight (Monoisotopic): 472.2111AlogP: 3.21#Rotatable Bonds: 11Polar Surface Area: 115.27Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.87CX Basic pKa: ┄CX LogP: 2.53CX LogD: 2.53Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.25Np Likeness Score: -0.18
References 1. Viswanathan K, Hoover DJ, Hwang J, Wisniewski ML, Ikonne US, Bahr BA, Wright DL.. (2012) Nonpeptidic lysosomal modulators derived from z-phe-ala-diazomethylketone for treating protein accumulation diseases., 3 (11): [PMID:24900408 ] [10.1021/ml300197h ]