The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
trans-8-(4-Aminocyclohexylamino)-5-bromo-N-(4-phenoxybenzyl)-1,6-naphthyridine-7-carboxamide ID: ALA2180566
PubChem CID: 71452036
Max Phase: Preclinical
Molecular Formula: C28H28BrN5O2
Molecular Weight: 546.47
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N[C@H]1CC[C@H](Nc2c(C(=O)NCc3ccc(Oc4ccccc4)cc3)nc(Br)c3cccnc23)CC1
Standard InChI: InChI=1S/C28H28BrN5O2/c29-27-23-7-4-16-31-24(23)25(33-20-12-10-19(30)11-13-20)26(34-27)28(35)32-17-18-8-14-22(15-9-18)36-21-5-2-1-3-6-21/h1-9,14-16,19-20,33H,10-13,17,30H2,(H,32,35)/t19-,20-
Standard InChI Key: PMMWECVVZKUIQJ-MXVIHJGJSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
21.0227 -10.0085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0215 -10.8322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7337 -11.2452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4475 -10.8317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4447 -10.0049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7319 -9.5996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1600 -11.2433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8712 -10.8295 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.5836 -11.2411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2948 -10.8272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5849 -12.0624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.0019 -11.2402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9943 -9.5975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2906 -10.0089 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.7118 -10.0049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7089 -10.8239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4162 -11.2362 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.1269 -10.8264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1258 -10.0043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4179 -9.5998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9901 -8.7762 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
26.0044 -12.0615 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.7133 -12.4680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7118 -13.2820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4166 -13.6884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1255 -13.2811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1250 -12.4630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4156 -12.0521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8329 -13.6902 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3154 -9.5992 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.3162 -8.7820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0247 -8.3794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0259 -7.5629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3181 -7.1528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6076 -7.5651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6099 -8.3802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
10 12 2 0
12 16 1 0
15 13 1 0
13 14 2 0
14 10 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 15 2 0
13 21 1 0
12 22 1 0
23 22 1 1
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
26 29 1 6
1 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 546.47Molecular Weight (Monoisotopic): 545.1426AlogP: 5.80#Rotatable Bonds: 7Polar Surface Area: 102.16Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.19CX Basic pKa: 10.45CX LogP: 5.00CX LogD: 2.26Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.25Np Likeness Score: -0.97
References 1. Zeng LF, Wang Y, Kazemi R, Xu S, Xu ZL, Sanchez TW, Yang LM, Debnath B, Odde S, Xie H, Zheng YT, Ding J, Neamati N, Long YQ.. (2012) Repositioning HIV-1 integrase inhibitors for cancer therapeutics: 1,6-naphthyridine-7-carboxamide as a promising scaffold with drug-like properties., 55 (22): [PMID:23098137 ] [10.1021/jm300667v ]