The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
trans-8-((4-Aminocyclohexyl)amino)-5-bromo-N-(3-(trifluoromethyl)benzyl)-1,6-naphthyridine-7-carboxamide ID: ALA2180569
PubChem CID: 45376975
Max Phase: Preclinical
Molecular Formula: C23H23BrF3N5O
Molecular Weight: 522.37
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N[C@H]1CC[C@H](Nc2c(C(=O)NCc3cccc(C(F)(F)F)c3)nc(Br)c3cccnc23)CC1
Standard InChI: InChI=1S/C23H23BrF3N5O/c24-21-17-5-2-10-29-18(17)19(31-16-8-6-15(28)7-9-16)20(32-21)22(33)30-12-13-3-1-4-14(11-13)23(25,26)27/h1-5,10-11,15-16,31H,6-9,12,28H2,(H,30,33)/t15-,16-
Standard InChI Key: LEORXJSUBJNFPF-WKILWMFISA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
11.9717 -16.6121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9705 -17.4357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6827 -17.8488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3965 -17.4352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3937 -16.6085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6809 -16.2032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1090 -17.8469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8202 -17.4330 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5326 -17.8446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2438 -17.4308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5339 -18.6660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9509 -17.8438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9433 -16.2011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2396 -16.6125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6608 -16.6084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6579 -17.4275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3652 -17.8398 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0759 -17.4300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0748 -16.6078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3669 -16.2034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9391 -15.3798 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
16.9534 -18.6651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6623 -19.0715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6607 -19.8856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3656 -20.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0745 -19.8847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0740 -19.0665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3646 -18.6557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7819 -20.2938 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6785 -15.3860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3850 -14.9753 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.9696 -14.9795 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.6706 -14.5650 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
10 12 2 0
12 16 1 0
15 13 1 0
13 14 2 0
14 10 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 15 2 0
13 21 1 0
12 22 1 0
23 22 1 1
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
26 29 1 6
6 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 522.37Molecular Weight (Monoisotopic): 521.1038AlogP: 5.02#Rotatable Bonds: 5Polar Surface Area: 92.93Molecular Species: BASEHBA: 5HBD: 3#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.62CX Basic pKa: 10.45CX LogP: 4.38CX LogD: 1.64Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.41Np Likeness Score: -1.35
References 1. Zeng LF, Wang Y, Kazemi R, Xu S, Xu ZL, Sanchez TW, Yang LM, Debnath B, Odde S, Xie H, Zheng YT, Ding J, Neamati N, Long YQ.. (2012) Repositioning HIV-1 integrase inhibitors for cancer therapeutics: 1,6-naphthyridine-7-carboxamide as a promising scaffold with drug-like properties., 55 (22): [PMID:23098137 ] [10.1021/jm300667v ]