The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-amino-N-((S)-1-((S)-1-amino-1-oxo-3-phenylpropan-2-ylamino)-5-guanidino-1-oxopentan-2-yl)-4-methylpentanamide ID: ALA2181307
PubChem CID: 71453914
Max Phase: Preclinical
Molecular Formula: C21H35N7O3
Molecular Weight: 433.56
Molecule Type: Protein
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccccc1)C(N)=O
Standard InChI: InChI=1S/C21H35N7O3/c1-13(2)11-15(22)19(30)27-16(9-6-10-26-21(24)25)20(31)28-17(18(23)29)12-14-7-4-3-5-8-14/h3-5,7-8,13,15-17H,6,9-12,22H2,1-2H3,(H2,23,29)(H,27,30)(H,28,31)(H4,24,25,26)/t15-,16-,17-/m0/s1
Standard InChI Key: ZVGJPQMEEYQNAU-ULQDDVLXSA-N
Molfile:
RDKit 2D
31 31 0 0 0 0 0 0 0 0999 V2000
19.8252 -19.8025 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2487 -19.0953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4751 -19.8315 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0716 -19.1100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8493 -18.3733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2729 -17.6661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8735 -16.9442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0999 -17.6804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7710 -19.8898 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.1700 -20.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7464 -21.3148 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.9970 -20.6219 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.4993 -18.4023 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3222 -18.4170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3464 -16.9879 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7499 -17.7094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7216 -19.1390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5487 -19.1531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9480 -19.8751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5728 -17.7240 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.9964 -17.0168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2228 -17.7530 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.8234 -17.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5970 -16.2949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6227 -14.8685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0206 -15.5877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8448 -15.6060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2704 -14.8970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8726 -14.1778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0487 -14.1636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2470 -16.3239 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4 13 1 0
16 20 1 0
23 31 1 0
1 2 1 0
2 4 1 0
4 3 2 0
2 5 1 1
5 6 1 0
6 7 1 0
6 8 1 0
9 10 1 0
10 11 1 0
10 12 2 0
13 14 1 0
14 16 1 0
16 15 2 0
14 17 1 6
17 18 1 0
18 19 1 0
19 9 1 0
20 21 1 0
21 23 1 0
23 22 2 0
21 24 1 1
24 26 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 433.56Molecular Weight (Monoisotopic): 433.2801AlogP: -0.68#Rotatable Bonds: 13Polar Surface Area: 189.21Molecular Species: BASEHBA: 5HBD: 7#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 10#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.40CX Basic pKa: 11.81CX LogP: -0.78CX LogD: -3.65Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.12Np Likeness Score: 0.20
References 1. Nichols R, Bass C, Demers L, Larsen B, Li E, Blewett N, Converso-Baran K, Russell MW, Westfall MV.. (2012) Structure-activity studies of RFamide-related peptide-1 identify a functional receptor antagonist and novel cardiac myocyte signaling pathway involved in contractile performance., 55 (17): [PMID:22909119 ] [10.1021/jm300760m ]