The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(+/-)-3-O-[4-(4,5-dihydro-5-oxo-1,2,4-4H-oxadiazol-3-yl)phenyl]-2-O-tetradecylglycerol ID: ALA219946
PubChem CID: 135540876
Max Phase: Preclinical
Molecular Formula: C25H40N2O5
Molecular Weight: 448.60
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCCCCCOC(CO)COc1ccc(-c2noc(=O)[nH]2)cc1
Standard InChI: InChI=1S/C25H40N2O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-18-30-23(19-28)20-31-22-16-14-21(15-17-22)24-26-25(29)32-27-24/h14-17,23,28H,2-13,18-20H2,1H3,(H,26,27,29)
Standard InChI Key: PTHGHMSPAXULKP-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 33 0 0 0 0 0 0 0 0999 V2000
7.6258 -26.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3419 -27.1658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0605 -26.7551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0643 -25.9299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3450 -25.5114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6292 -25.9245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7735 -27.1735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8563 -27.9997 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6671 -28.1762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0793 -27.4601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5266 -26.8434 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9037 -27.3772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9037 -25.8901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6188 -25.4786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3296 -25.8859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0446 -25.4744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7596 -25.8817 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9193 -25.4978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1934 -25.9014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4822 -25.4801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4934 -24.6529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7823 -24.2275 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1915 -25.4776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4782 -25.8882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2341 -25.4757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9474 -25.8863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6597 -25.4738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3730 -25.8844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0836 -25.4719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7974 -25.8818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5092 -25.4686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2230 -25.8784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15 16 1 0
3 4 2 0
16 17 1 0
4 5 1 0
18 19 1 0
2 3 1 0
19 20 1 0
20 17 1 0
7 8 2 0
20 21 1 0
9 10 1 0
21 22 1 0
18 6 1 0
10 11 1 0
13 23 1 0
11 7 1 0
23 24 1 0
5 6 2 0
24 25 1 0
10 12 2 0
25 26 1 0
6 1 1 0
26 27 1 0
1 2 2 0
27 28 1 0
13 14 1 0
28 29 1 0
3 7 1 0
29 30 1 0
14 15 1 0
30 31 1 0
8 9 1 0
31 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 448.60Molecular Weight (Monoisotopic): 448.2937AlogP: 5.49#Rotatable Bonds: 19Polar Surface Area: 97.58Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 5.94CX Basic pKa: ┄CX LogP: 6.60CX LogD: 5.75Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.28Np Likeness Score: -0.20
References 1. Touaibia M, Djimdé A, Cao F, Boilard E, Bezzine S, Lambeau G, Redeuilh C, Lamouri A, Massicot F, Chau F, Dong CZ, Heymans F.. (2007) Inhibition of secreted phospholipase A2. 4-glycerol derivatives of 4,5-dihydro-3-(4-tetradecyloxybenzyl)-1,2,4-4H-oxadiazol-5-one with broad activities., 50 (7): [PMID:17335183 ] [10.1021/jm060082n ]