The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-fluoro-4-(5-fluoro-6-(4-(3-(2-fluoropropan-2-yl)-1,2,4-oxadiazol-5-yl)piperidin-1-yl)pyrimidin-4-ylamino)-N,N-dimethylbenzamide ID: ALA2204980
PubChem CID: 56943106
Max Phase: Preclinical
Molecular Formula: C23H26F3N7O2
Molecular Weight: 489.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)C(=O)c1ccc(Nc2ncnc(N3CCC(c4nc(C(C)(C)F)no4)CC3)c2F)c(F)c1
Standard InChI: InChI=1S/C23H26F3N7O2/c1-23(2,26)22-30-20(35-31-22)13-7-9-33(10-8-13)19-17(25)18(27-12-28-19)29-16-6-5-14(11-15(16)24)21(34)32(3)4/h5-6,11-13H,7-10H2,1-4H3,(H,27,28,29)
Standard InChI Key: XGJZRVVCWLCQCJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
6.9082 -4.5624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7332 -4.5624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1435 -3.8519 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7332 -3.1369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9082 -3.1369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4935 -3.8519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9640 -3.8520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3749 -4.5687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1991 -4.5702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6134 -3.8558 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1975 -3.1383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3746 -3.1404 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6674 -3.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1824 -3.1878 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3972 -3.4440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3997 -4.2701 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1863 -4.5216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7288 -2.9604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9000 -2.9541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3083 -3.6708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7208 -2.1333 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.9607 -5.2821 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.6103 -5.2854 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4353 -5.2869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8409 -6.0023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6651 -6.0043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0799 -5.2900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6642 -4.5724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8414 -4.5740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4249 -6.7147 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.9049 -5.2904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3177 -4.5762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3170 -6.0052 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9041 -6.7193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1420 -6.0056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
3 7 1 0
14 15 1 0
13 14 2 0
15 16 2 0
16 17 1 0
17 13 1 0
6 13 1 0
15 18 1 0
18 19 1 0
18 20 1 0
18 21 1 0
8 22 1 0
9 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
25 30 1 0
27 31 1 0
31 32 2 0
31 33 1 0
33 34 1 0
33 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 489.50Molecular Weight (Monoisotopic): 489.2100AlogP: 4.17#Rotatable Bonds: 6Polar Surface Area: 100.28Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.73CX Basic pKa: 3.59CX LogP: 3.88CX LogD: 3.88Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.55Np Likeness Score: -2.02
References 1. Abdel-Magid AF.. (2012) GPR119 Modulators for the Treatment of Diabetes, Obesity, and Related Diseases: Patent Highlight., 3 (12): [PMID:24900416 ] [10.1021/ml300296q ]