The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(tert-butyl)-N-(2-(tert-butylamino)-1-(4'-methoxy-[1,1'-biphenyl]-4-yl)-2-oxoethyl)-3-(3,4-dihydroxyphenyl)propanamide ID: ALA2205125
PubChem CID: 71452320
Max Phase: Preclinical
Molecular Formula: C32H40N2O5
Molecular Weight: 532.68
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2ccc(C(C(=O)NC(C)(C)C)N(C(=O)CCc3ccc(O)c(O)c3)C(C)(C)C)cc2)cc1
Standard InChI: InChI=1S/C32H40N2O5/c1-31(2,3)33-30(38)29(24-12-10-22(11-13-24)23-14-16-25(39-7)17-15-23)34(32(4,5)6)28(37)19-9-21-8-18-26(35)27(36)20-21/h8,10-18,20,29,35-36H,9,19H2,1-7H3,(H,33,38)
Standard InChI Key: QGMMFKZFRXRRCM-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 41 0 0 0 0 0 0 0 0999 V2000
5.4007 -4.1711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6830 -4.5837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9695 -4.1711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4007 -3.3460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1142 -4.5837 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2560 -4.5837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2560 -5.4087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5424 -5.8212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8248 -5.4087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8248 -4.5837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5424 -4.1711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1112 -5.8212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5424 -6.6463 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8278 -4.1711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8278 -3.3460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5412 -2.9335 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9724 -5.4087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2589 -5.8212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5412 -5.4087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5412 -4.5837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2589 -4.1711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9724 -4.5837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6860 -5.8212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3995 -5.4087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1172 -5.8212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1172 -6.6463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3995 -7.0589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6860 -6.6463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8307 -7.0589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5442 -6.6463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1142 -2.9335 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1142 -2.1084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1142 -5.4087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3997 -5.8212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8288 -5.8212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1090 -6.2299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8288 -1.6958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3997 -1.6958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1090 -1.2794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
1 4 2 0
1 5 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
6 11 2 0
9 12 1 0
8 13 1 0
3 6 1 0
14 15 1 0
15 16 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
17 22 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
23 28 2 0
17 23 1 0
29 30 1 0
26 29 1 0
14 20 1 0
31 32 1 0
15 31 1 0
5 14 1 0
5 33 1 0
33 34 1 0
33 35 1 0
33 36 1 0
32 37 1 0
32 38 1 0
32 39 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 532.68Molecular Weight (Monoisotopic): 532.2937AlogP: 5.99#Rotatable Bonds: 8Polar Surface Area: 99.10Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.29CX Basic pKa: ┄CX LogP: 5.52CX LogD: 5.51Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.31Np Likeness Score: -0.61
References 1. Kravchenko VV, Gloeckner C, Stowe GN, Kang YJ, Tobias PS, Mathison JC, Ulevitch RJ, Kaufmann GF, Janda KD.. (2012) The use of small molecule probes to study spatially separated stimulus-induced signaling pathways., 22 (5): [PMID:22300658 ] [10.1016/j.bmcl.2012.01.024 ]