The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-3-Amino-4-(2-fluoro-phenyl)-N-{4-[4-(4-fluoro-phenyl)-thiazol-2-yl]-1,1-dioxo-hexahydro-1lambda*6*-thiopyran-4-yl}-butyramide ID: ALA2206482
PubChem CID: 71463122
Max Phase: Preclinical
Molecular Formula: C24H25F2N3O3S2
Molecular Weight: 505.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N[C@@H](CC(=O)NC1(c2nc(-c3ccc(F)cc3)cs2)CCS(=O)(=O)CC1)Cc1ccccc1F
Standard InChI: InChI=1S/C24H25F2N3O3S2/c25-18-7-5-16(6-8-18)21-15-33-23(28-21)24(9-11-34(31,32)12-10-24)29-22(30)14-19(27)13-17-3-1-2-4-20(17)26/h1-8,15,19H,9-14,27H2,(H,29,30)/t19-/m1/s1
Standard InChI Key: DINSMNCBXHZOQU-LJQANCHMSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
26.4824 -2.0659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4824 -2.8909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1944 -3.2993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9063 -2.8909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9063 -2.0659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1944 -1.6493 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.4775 -2.4791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4763 -3.3065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1911 -3.7194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9076 -3.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9048 -2.4755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1894 -2.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1909 -4.5444 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.6227 -3.7173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3365 -3.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0517 -3.7151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3352 -2.4787 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.7654 -3.3015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4806 -3.7129 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.7642 -2.4765 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.9095 -3.7106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7747 -0.9292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.5997 -0.9292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.9928 -4.5315 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
28.8008 -4.7022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2117 -3.9854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6560 -3.3742 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.0315 -3.8958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5187 -4.5630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3381 -4.4740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6714 -3.7184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1792 -3.0510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3616 -3.1434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4914 -3.6278 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
9 13 1 0
10 14 1 0
14 15 1 0
15 16 1 0
15 17 1 1
16 18 1 0
18 19 1 0
18 20 2 0
19 3 1 0
3 21 1 0
6 22 2 0
6 23 2 0
24 25 1 0
21 24 1 0
25 26 2 0
26 27 1 0
27 21 2 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
26 28 1 0
31 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 505.61Molecular Weight (Monoisotopic): 505.1305AlogP: 3.57#Rotatable Bonds: 7Polar Surface Area: 102.15Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.01CX Basic pKa: 8.41CX LogP: 2.42CX LogD: 1.37Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.51Np Likeness Score: -1.29
References 1. Nitta A, Fujii H, Sakami S, Satoh M, Nakaki J, Satoh S, Kumagai H, Kawai H.. (2012) Novel series of 3-amino-N-(4-aryl-1,1-dioxothian-4-yl)butanamides as potent and selective dipeptidyl peptidase IV inhibitors., 22 (23): [PMID:23072865 ] [10.1016/j.bmcl.2012.09.099 ]