(1R,5R)-3-benzyl-N-((S)-1-hydroxy-4-methylpentan-2-yl)-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide

ID: ALA2206670

PubChem CID: 71463142

Max Phase: Preclinical

Molecular Formula: C19H26N2O5

Molecular Weight: 362.43

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)C[C@@H](CO)NC(=O)C1O[C@H]2CN(Cc3ccccc3)C(=O)[C@@H]1O2

Standard InChI:  InChI=1S/C19H26N2O5/c1-12(2)8-14(11-22)20-18(23)16-17-19(24)21(10-15(25-16)26-17)9-13-6-4-3-5-7-13/h3-7,12,14-17,22H,8-11H2,1-2H3,(H,20,23)/t14-,15+,16?,17+/m0/s1

Standard InChI Key:  YLFMGINTBAGZCH-RUENRELNSA-N

Molfile:  

     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   16.0015   -3.3629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6920   -4.1218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1942   -4.7671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0057   -4.6548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3127   -3.8916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8086   -3.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1139   -2.4914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9230   -2.3767    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.1726   -1.6009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9371   -1.3067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3813   -3.0560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6425   -1.7167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.1972   -3.1225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7560   -2.5248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9687   -3.7614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8033   -2.1934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5352   -2.7711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7115   -3.5691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.1381   -2.2195    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.9170   -2.4700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0353   -0.4955    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   19.5063   -3.8790    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   22.0892   -3.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5227   -1.9215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3006   -2.1717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.8671   -3.5191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0394   -4.3180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4728   -2.9705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  8 11  1  0
 10 12  1  0
 11 13  1  0
 12 14  1  0
 13 14  1  0
 11 15  2  0
 10 16  1  0
 13 16  1  0
 14 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
 10 21  1  1
 13 22  1  1
 20 23  1  6
 20 24  1  0
 24 25  1  0
 23 26  1  0
 26 27  1  0
 26 28  1  0
M  END

Associated Targets(non-human)

SAP2 Candidapepsin-2 (159 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 362.43Molecular Weight (Monoisotopic): 362.1842AlogP: 0.66#Rotatable Bonds: 7
Polar Surface Area: 88.10Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.96CX Basic pKa: CX LogP: 1.20CX LogD: 1.20
Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.74Np Likeness Score: -0.06

References

1. Calugi C, Trabocchi A, De Bernardis F, Arancia S, Navarra P, Cauda R, Cassone A, Guarna A..  (2012)  Bicyclic peptidomimetics targeting secreted aspartic protease 2 (SAP2) from Candida albicans reveal a constrained inhibitory chemotype.,  20  (24): [PMID:23123016] [10.1016/j.bmc.2012.09.031]

Source