(1S,5S)-3-benzyl-N-((S)-1-hydroxy-4-methylpentan-2-yl)-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide

ID: ALA2206671

PubChem CID: 71455975

Max Phase: Preclinical

Molecular Formula: C19H26N2O5

Molecular Weight: 362.43

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)C[C@@H](CO)NC(=O)C1O[C@@H]2CN(Cc3ccccc3)C(=O)[C@H]1O2

Standard InChI:  InChI=1S/C19H26N2O5/c1-12(2)8-14(11-22)20-18(23)16-17-19(24)21(10-15(25-16)26-17)9-13-6-4-3-5-7-13/h3-7,12,14-17,22H,8-11H2,1-2H3,(H,20,23)/t14-,15-,16?,17-/m0/s1

Standard InChI Key:  YLFMGINTBAGZCH-KWEKYREISA-N

Molfile:  

     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   25.1433   -3.2350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8339   -3.9939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3360   -4.6392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1475   -4.5269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4545   -3.7636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9504   -3.1215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2557   -2.3635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0648   -2.2488    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.3144   -1.4730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0789   -1.1788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5231   -2.9281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7843   -1.5888    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.3390   -2.9945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8978   -2.3969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1106   -3.6335    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.9451   -2.0655    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.6770   -2.6432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8533   -3.4411    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.2799   -2.0915    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.0588   -2.3421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1771   -0.3675    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   28.6481   -3.7510    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   31.2310   -3.1409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6645   -1.7935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4424   -2.0438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.0090   -3.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1812   -4.1900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6146   -2.8426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  8 11  1  0
 10 12  1  0
 11 13  1  0
 12 14  1  0
 13 14  1  0
 11 15  2  0
 10 16  1  0
 13 16  1  0
 14 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
 10 21  1  6
 13 22  1  6
 20 23  1  6
 20 24  1  0
 24 25  1  0
 23 26  1  0
 26 27  1  0
 26 28  1  0
M  END

Associated Targets(non-human)

SAP2 Candidapepsin-2 (159 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 362.43Molecular Weight (Monoisotopic): 362.1842AlogP: 0.66#Rotatable Bonds: 7
Polar Surface Area: 88.10Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.96CX Basic pKa: CX LogP: 1.20CX LogD: 1.20
Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.74Np Likeness Score: -0.06

References

1. Calugi C, Trabocchi A, De Bernardis F, Arancia S, Navarra P, Cauda R, Cassone A, Guarna A..  (2012)  Bicyclic peptidomimetics targeting secreted aspartic protease 2 (SAP2) from Candida albicans reveal a constrained inhibitory chemotype.,  20  (24): [PMID:23123016] [10.1016/j.bmc.2012.09.031]

Source