(1R,5R)-3-benzyl-N-((R)-1-hydroxy-4-methylpentan-2-yl)-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide

ID: ALA2206672

PubChem CID: 71450623

Max Phase: Preclinical

Molecular Formula: C19H26N2O5

Molecular Weight: 362.43

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)C[C@H](CO)NC(=O)C1O[C@H]2CN(Cc3ccccc3)C(=O)[C@@H]1O2

Standard InChI:  InChI=1S/C19H26N2O5/c1-12(2)8-14(11-22)20-18(23)16-17-19(24)21(10-15(25-16)26-17)9-13-6-4-3-5-7-13/h3-7,12,14-17,22H,8-11H2,1-2H3,(H,20,23)/t14-,15-,16?,17-/m1/s1

Standard InChI Key:  YLFMGINTBAGZCH-FRBBGCKASA-N

Molfile:  

     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   -1.4324  -10.1068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7420  -10.8657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2453  -11.5110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4308  -11.3987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1269  -10.6355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6299   -9.9933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3243   -9.2353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4896   -9.1206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7392   -8.3448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5036   -8.0506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9479   -9.7999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2091   -8.4606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7638   -9.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3226   -9.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5353  -10.5053    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3699   -8.9373    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1018   -9.5150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2781  -10.3130    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7046   -8.9634    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4836   -9.2139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6019   -7.2394    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0729  -10.6229    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6558  -10.0128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0892   -8.6654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8672   -8.9156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4337  -10.2630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6060  -11.0619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0394   -9.7144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  8 11  1  0
 10 12  1  0
 11 13  1  0
 12 14  1  0
 13 14  1  0
 11 15  2  0
 10 16  1  0
 16 13  1  0
 14 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
 10 21  1  1
 13 22  1  1
 20 23  1  1
 20 24  1  0
 24 25  1  0
 23 26  1  0
 26 27  1  0
 26 28  1  0
M  END

Associated Targets(non-human)

SAP2 Candidapepsin-2 (159 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 362.43Molecular Weight (Monoisotopic): 362.1842AlogP: 0.66#Rotatable Bonds: 7
Polar Surface Area: 88.10Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.96CX Basic pKa: CX LogP: 1.20CX LogD: 1.20
Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.74Np Likeness Score: -0.06

References

1. Calugi C, Trabocchi A, De Bernardis F, Arancia S, Navarra P, Cauda R, Cassone A, Guarna A..  (2012)  Bicyclic peptidomimetics targeting secreted aspartic protease 2 (SAP2) from Candida albicans reveal a constrained inhibitory chemotype.,  20  (24): [PMID:23123016] [10.1016/j.bmc.2012.09.031]

Source