The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-Methyl 4-methyl-2-[(1R,5R,7R)-2-oxo-7-(piperidine-1-carbonyl)-6,8-dioxa-3-azabicyclo[3.2.1]octan-3-yl]pentanoate ID: ALA2206676
PubChem CID: 71450624
Max Phase: Preclinical
Molecular Formula: C18H28N2O6
Molecular Weight: 368.43
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@@H](CC(C)C)N1C[C@@H]2O[C@@H](C(=O)N3CCCCC3)[C@@H](O2)C1=O
Standard InChI: InChI=1S/C18H28N2O6/c1-11(2)9-12(18(23)24-3)20-10-13-25-14(15(26-13)17(20)22)16(21)19-7-5-4-6-8-19/h11-15H,4-10H2,1-3H3/t12-,13-,14-,15-/m1/s1
Standard InChI Key: MNTZQPYJSPFTGX-KBUPBQIOSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
3.1929 -18.2313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4981 -17.4732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3073 -17.3586 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5569 -16.5828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3213 -16.2886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7656 -18.0379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0268 -16.6985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5815 -18.1043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1403 -17.5067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3530 -18.7432 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1876 -17.1753 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9194 -17.7530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0957 -18.5509 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5223 -17.2013 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3012 -17.4519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9028 -16.9041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7306 -16.1049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9511 -15.8564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3438 -16.4072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4196 -15.4773 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.8906 -18.8608 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.3838 -18.3460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0786 -19.1040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6968 -18.8747 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9943 -16.8299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2995 -16.0718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7957 -15.4285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1086 -15.9572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
3 6 1 0
5 7 1 0
6 8 1 0
7 9 1 0
8 9 1 0
6 10 2 0
5 11 1 0
11 8 1 0
9 12 1 1
12 13 2 0
12 14 1 0
14 15 1 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
5 20 1 1
8 21 1 1
1 22 1 0
22 23 1 0
1 24 2 0
2 25 1 1
25 26 1 0
26 27 1 0
26 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 368.43Molecular Weight (Monoisotopic): 368.1947AlogP: 0.54#Rotatable Bonds: 5Polar Surface Area: 85.38Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.04CX Basic pKa: ┄CX LogP: 1.02CX LogD: 1.02Aromatic Rings: ┄Heavy Atoms: 26QED Weighted: 0.66Np Likeness Score: -0.14
References 1. Calugi C, Trabocchi A, De Bernardis F, Arancia S, Navarra P, Cauda R, Cassone A, Guarna A.. (2012) Bicyclic peptidomimetics targeting secreted aspartic protease 2 (SAP2) from Candida albicans reveal a constrained inhibitory chemotype., 20 (24): [PMID:23123016 ] [10.1016/j.bmc.2012.09.031 ]