The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-[3-(1-Pentyn-1-yl)azulen-1-ylmethyl]-4-(2-methoxyphenyl)piperazine ID: ALA2207634
PubChem CID: 71459760
Max Phase: Preclinical
Molecular Formula: C27H30N2O
Molecular Weight: 398.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCC#Cc1cc(CN2CCN(c3ccccc3OC)CC2)c2cccccc1-2
Standard InChI: InChI=1S/C27H30N2O/c1-3-4-6-11-22-20-23(25-13-8-5-7-12-24(22)25)21-28-16-18-29(19-17-28)26-14-9-10-15-27(26)30-2/h5,7-10,12-15,20H,3-4,16-19,21H2,1-2H3
Standard InChI Key: RSTJJQONPRJAIE-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
15.8986 -4.7528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6433 -4.4063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7059 -5.5568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2148 -6.2080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0408 -6.2138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3826 -4.7765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5630 -5.5767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3798 -5.6524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7042 -4.8990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0883 -4.3577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0746 -3.5328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7821 -3.1085 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5054 -3.5080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2108 -3.0872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2013 -2.2619 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4810 -1.8665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7692 -2.2873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9076 -1.8373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6292 -2.2396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3363 -1.8160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3231 -0.9902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5968 -0.5899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8927 -1.0158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6421 -3.0646 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.3628 -3.4659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8011 -6.3618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2251 -7.0687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6494 -7.7762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2489 -8.4975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6732 -9.2050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 6 1 0
1 3 1 0
3 4 2 0
7 5 2 0
4 5 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 6 2 0
10 11 1 0
11 12 1 0
12 13 1 0
12 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
15 18 1 0
19 24 1 0
24 25 1 0
8 26 1 0
26 27 3 0
27 28 1 0
28 29 1 0
29 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 398.55Molecular Weight (Monoisotopic): 398.2358AlogP: 5.27#Rotatable Bonds: 5Polar Surface Area: 15.71Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.93CX LogP: 6.36CX LogD: 5.72Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.54Np Likeness Score: -0.78
References 1. Löber S, Hübner H, Buschauer A, Sanna F, Argiolas A, Melis MR, Gmeiner P.. (2012) Novel azulene derivatives for the treatment of erectile dysfunction., 22 (23): [PMID:23099096 ] [10.1016/j.bmcl.2012.09.064 ]