7-(3-(3-tert-butyl-1-p-tolyl-1H-pyrazol-5-yl)ureido)-N-(3-chlorophenyl)-1H-indole-2-carboxamide

ID: ALA2207821

PubChem CID: 71454308

Max Phase: Preclinical

Molecular Formula: C30H29ClN6O2

Molecular Weight: 541.06

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(-n2nc(C(C)(C)C)cc2NC(=O)Nc2cccc3cc(C(=O)Nc4cccc(Cl)c4)[nH]c23)cc1

Standard InChI:  InChI=1S/C30H29ClN6O2/c1-18-11-13-22(14-12-18)37-26(17-25(36-37)30(2,3)4)35-29(39)34-23-10-5-7-19-15-24(33-27(19)23)28(38)32-21-9-6-8-20(31)16-21/h5-17,33H,1-4H3,(H,32,38)(H2,34,35,39)

Standard InChI Key:  DWYCGUDGRAMCRE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   11.9458   -6.0157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6538   -6.4246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3635   -6.0152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3606   -5.1925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0664   -4.7806    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.7760   -5.1859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4818   -4.7739    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.7799   -6.0030    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1909   -5.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1488   -5.9936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9144   -6.2819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4242   -5.6418    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9714   -4.9601    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1316   -7.0697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5580   -7.6517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9225   -7.2755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3385   -7.8541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3866   -4.2588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2049   -4.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6208   -3.5662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2197   -2.8533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3983   -2.8472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9860   -3.5503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6348   -2.1494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3409   -4.6534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9464   -5.1975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6510   -4.7885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4782   -3.9921    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6674   -3.9116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2553   -3.2060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6604   -2.4962    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4381   -3.2101    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0272   -2.5038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4355   -1.7985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0252   -1.0926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2071   -1.0949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8011   -1.8090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2137   -2.5119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4317   -0.3837    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
 26  1  2  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4 27  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  2  0
  7  9  1  0
 10 11  1  0
  9 10  2  0
 11 12  2  0
 12 13  1  0
 13  9  1  0
 11 14  1  0
 14 15  1  0
 14 16  1  0
 14 17  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 13 18  1  0
 21 24  1  0
 26 27  1  0
 25 26  1  0
 27 28  1  0
 28 29  1  0
 29 25  2  0
 29 30  1  0
 30 31  2  0
 30 32  1  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 33  1  0
 35 39  1  0
M  END

Associated Targets(Human)

PTK2B Tclin Protein tyrosine kinase 2 beta (2827 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 541.06Molecular Weight (Monoisotopic): 540.2041AlogP: 7.51#Rotatable Bonds: 5
Polar Surface Area: 103.84Molecular Species: NEUTRALHBA: 4HBD: 4
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 10.61CX Basic pKa: 1.90CX LogP: 7.45CX LogD: 7.45
Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.19Np Likeness Score: -1.91

References

1. Bhattacharya SK, Aspnes GE, Bagley SW, Boehm M, Brosius AD, Buckbinder L, Chang JS, Dibrino J, Eng H, Frederick KS, Griffith DA, Griffor MC, Guimarães CR, Guzman-Perez A, Han S, Kalgutkar AS, Klug-McLeod J, Garcia-Irizarry C, Li J, Lippa B, Price DA, Southers JA, Walker DP, Wei L, Xiao J, Zawistoski MP, Zhao X..  (2012)  Identification of novel series of pyrazole and indole-urea based DFG-out PYK2 inhibitors.,  22  (24): [PMID:23153798] [10.1016/j.bmcl.2012.10.039]

Source